The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-(tert-butyl)isoxazol-3-yl)-3-(4-(2-methyl-4,5-dihydro-2H-imidazo[2',1':2,3]thiazolo[4,5-e]isoindol-8-yl)phenyl)urea ID: ALA5206333
PubChem CID: 168295642
Max Phase: Preclinical
Molecular Formula: C26H26N6O2S
Molecular Weight: 486.60
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc2c(c1)-c1c(sc3nc(-c4ccc(NC(=O)Nc5cc(C(C)(C)C)on5)cc4)cn13)CC2
Standard InChI: InChI=1S/C26H26N6O2S/c1-26(2,3)21-11-22(30-34-21)29-24(33)27-17-8-5-15(6-9-17)19-14-32-23-18-13-31(4)12-16(18)7-10-20(23)35-25(32)28-19/h5-6,8-9,11-14H,7,10H2,1-4H3,(H2,27,29,30,33)
Standard InChI Key: NQRQJUYGBOBQOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-2.3200 -2.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6056 -2.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8911 -2.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8911 -3.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6056 -4.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3200 -3.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1065 -4.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3783 -3.4067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1065 -2.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2031 -3.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7771 -1.7747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5975 -1.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9330 -2.4420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.7689 -0.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0544 -0.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4415 -1.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0544 0.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7686 0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7678 1.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0534 2.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3419 1.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3371 0.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0534 2.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3392 3.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6249 2.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3392 4.0648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0893 3.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1754 4.0598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9818 4.2312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3940 3.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8423 2.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2187 3.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6311 4.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2187 2.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9330 3.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 2 0
8 7 1 0
9 8 1 0
3 9 2 0
8 10 1 0
2 11 1 0
12 11 1 0
13 12 1 0
1 13 1 0
12 14 2 0
14 15 1 0
15 16 2 0
11 16 1 0
17 15 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
28 27 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
30 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.60Molecular Weight (Monoisotopic): 486.1838AlogP: 6.10#Rotatable Bonds: 3Polar Surface Area: 89.39Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.27CX Basic pKa: 3.85CX LogP: 5.96CX LogD: 5.91Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.67
References 1. Cilibrasi V, Spanò V, Bortolozzi R, Barreca M, Raimondi MV, Rocca R, Maruca A, Montalbano A, Alcaro S, Ronca R, Viola G, Barraja P.. (2022) Synthesis of 2H-Imidazo[2',1':2,3] [1,3]thiazolo[4,5-e]isoindol-8-yl-phenylureas with promising therapeutic features for the treatment of acute myeloid leukemia (AML) with FLT3/ITD mutations., 235 [PMID:35339838 ] [10.1016/j.ejmech.2022.114292 ]