The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-nitro-2-(4-phenethylpiperazin-1-yl)-6-(trifluoromethyl)-4H-benzo[e][1,3]thiazin-4-one ID: ALA5206457
PubChem CID: 73947199
Max Phase: Preclinical
Molecular Formula: C21H19F3N4O3S
Molecular Weight: 464.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1nc(N2CCN(CCc3ccccc3)CC2)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12
Standard InChI: InChI=1S/C21H19F3N4O3S/c22-21(23,24)15-12-16-18(17(13-15)28(30)31)32-20(25-19(16)29)27-10-8-26(9-11-27)7-6-14-4-2-1-3-5-14/h1-5,12-13H,6-11H2
Standard InChI Key: XOPBQPIQFCHGRD-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.4338 0.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4338 0.8331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7184 -0.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0022 0.0034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0022 0.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7203 1.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7165 -0.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4362 0.0068 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1491 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1491 -1.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4340 -1.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7165 -1.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4340 -2.4774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8662 -1.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5822 -1.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5822 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8662 0.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8662 0.8328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5806 1.2452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1518 1.2452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2961 -1.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2948 -2.4796 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0107 -1.2417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0107 -2.0670 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1485 1.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8663 0.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5811 1.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5816 2.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2946 2.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0094 2.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0107 1.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2987 0.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
2 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
7 12 2 0
11 13 2 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 9 1 0
17 18 1 0
18 19 2 0
18 20 1 0
15 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
2 25 1 0
25 26 1 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
M CHG 2 18 1 20 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.47Molecular Weight (Monoisotopic): 464.1130AlogP: 3.95#Rotatable Bonds: 5Polar Surface Area: 79.58Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.71CX LogP: 4.43CX LogD: 4.35Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.70
References 1. Schieferdecker S, Bernal FA, Wojtas KP, Keiff F, Li Y, Dahse HM, Kloss F.. (2022) Development of Predictive Classification Models for Whole Cell Antimycobacterial Activity of Benzothiazinones., 65 (9.0): [PMID:35502994 ] [10.1021/acs.jmedchem.2c00098 ]