N-(1-isopropylpiperidin-4-yl)-1-(2-oxo-2-(phenylamino)ethyl)-1H-indole-2-carboxamide

ID: ALA5206688

PubChem CID: 102481208

Max Phase: Preclinical

Molecular Formula: C25H30N4O2

Molecular Weight: 418.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1CCC(NC(=O)c2cc3ccccc3n2CC(=O)Nc2ccccc2)CC1

Standard InChI:  InChI=1S/C25H30N4O2/c1-18(2)28-14-12-21(13-15-28)27-25(31)23-16-19-8-6-7-11-22(19)29(23)17-24(30)26-20-9-4-3-5-10-20/h3-11,16,18,21H,12-15,17H2,1-2H3,(H,26,30)(H,27,31)

Standard InChI Key:  DPXUVGXTMKQYGZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    1.3480    1.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9356    2.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3480    2.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    2.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5855    2.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    1.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4103    2.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8226    2.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8226    1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1108    2.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3014    1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1261    1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1108    0.6041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6107    0.6515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3947    0.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3947    1.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6107    1.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1067    0.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8208    0.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8226    1.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1118    2.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3972   -0.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9804   -0.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7669   -1.5248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7770   -0.5147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9703   -1.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3869   -1.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4070   -1.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6205   -2.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0414   -2.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7559   -2.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 15 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
 14 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
M  END

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.54Molecular Weight (Monoisotopic): 418.2369AlogP: 3.88#Rotatable Bonds: 6
Polar Surface Area: 66.37Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.34CX Basic pKa: 9.15CX LogP: 3.00CX LogD: 1.25
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.78

References

1. Fernández-Bachiller MI, Hwang S, Schembri ME, Lindemann P, Guberman M, Herziger S, Specker E, Matter H, Will DW, Czech J, Wagner M, Bauer A, Schreuder H, Ritter K, Urmann M, Wehner V, Sun H, Nazaré M..  (2022)  Probing Factor Xa Protein-Ligand Interactions: Accurate Free Energy Calculations and Experimental Validations of Two Series of High-Affinity Ligands.,  65  (19.0): [PMID:36178213] [10.1021/acs.jmedchem.2c00865]

Source