The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[4-(1H-indazol-6-ylamino)-5-methyl-pyrimidin-2-yl]amino]-N-(2-morpholinoethyl)benzamide ID: ALA5206707
PubChem CID: 156704685
Max Phase: Preclinical
Molecular Formula: C25H28N8O2
Molecular Weight: 472.55
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(Nc2ccc(C(=O)NCCN3CCOCC3)cc2)nc1Nc1ccc2cn[nH]c2c1
Standard InChI: InChI=1S/C25H28N8O2/c1-17-15-27-25(31-23(17)29-21-7-4-19-16-28-32-22(19)14-21)30-20-5-2-18(3-6-20)24(34)26-8-9-33-10-12-35-13-11-33/h2-7,14-16H,8-13H2,1H3,(H,26,34)(H,28,32)(H2,27,29,30,31)
Standard InChI Key: GIBYRJLRSLPQGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
0.7956 0.0033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5101 0.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2220 0.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2220 -0.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5120 -1.2331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7956 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0809 -1.2376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6337 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3485 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0605 -0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0605 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3502 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6337 0.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7752 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9367 -1.2339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6513 -0.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3661 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0782 -0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0782 0.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3679 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6513 0.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9367 0.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8632 -1.0768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8632 0.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3483 -0.4091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7752 1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4898 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2044 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9190 -0.8251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6337 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3483 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3483 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.6337 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9190 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
14 11 1 0
4 15 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
3 22 1 0
18 23 1 0
19 24 1 0
24 25 2 0
25 23 1 0
14 26 1 0
14 27 2 0
28 26 1 0
29 28 1 0
30 29 1 0
30 31 1 0
32 31 1 0
33 32 1 0
34 33 1 0
35 34 1 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2335AlogP: 3.21#Rotatable Bonds: 8Polar Surface Area: 120.09Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.15CX Basic pKa: 6.07CX LogP: 2.91CX LogD: 2.89Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.87
References 1. Chen X, Liu L, Liu P, Chen Y, Lin D, Yan H, Yan Q, Wang Y, Qiu Y, Fang B, Huang H, Qian J, Zhao Y, Du Z, Zhang Q, Li X, Zheng X, Liu Z.. (2022) Discovery of Potent and Orally Bioavailable Platelet-Derived Growth Factor Receptor (PDGFR) Inhibitors for the Treatment of Osteosarcoma., 65 (7.0): [PMID:35239349 ] [10.1021/acs.jmedchem.1c01732 ]