4-[[4-(1H-indazol-6-ylamino)-5-methyl-pyrimidin-2-yl]amino]-N-(2-morpholinoethyl)benzamide

ID: ALA5206707

PubChem CID: 156704685

Max Phase: Preclinical

Molecular Formula: C25H28N8O2

Molecular Weight: 472.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cnc(Nc2ccc(C(=O)NCCN3CCOCC3)cc2)nc1Nc1ccc2cn[nH]c2c1

Standard InChI:  InChI=1S/C25H28N8O2/c1-17-15-27-25(31-23(17)29-21-7-4-19-16-28-32-22(19)14-21)30-20-5-2-18(3-6-20)24(34)26-8-9-33-10-12-35-13-11-33/h2-7,14-16H,8-13H2,1H3,(H,26,34)(H,28,32)(H2,27,29,30,31)

Standard InChI Key:  GIBYRJLRSLPQGP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    0.7956    0.0033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5101    0.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2220    0.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2220   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5120   -1.2331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7956   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0809   -1.2376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6337   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3485   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0605   -0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0605   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3502    0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6337    0.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7752    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9367   -1.2339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6513   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3661   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0782   -0.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0782    0.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3679    0.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6513    0.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9367    0.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8632   -1.0768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8632    0.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3483   -0.4091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4898   -0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7752    1.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4898   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2044   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9190   -0.8251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6337   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3483   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3483    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6337    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9190    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 14 11  1  0
  4 15  1  0
 15 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
  3 22  1  0
 18 23  1  0
 19 24  1  0
 24 25  2  0
 25 23  1  0
 14 26  1  0
 14 27  2  0
 28 26  1  0
 29 28  1  0
 30 29  1  0
 30 31  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5206707

    ---

Associated Targets(Human)

PDGFRA Tclin Platelet-derived growth factor receptor alpha (5682 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDGFRB Tclin Platelet-derived growth factor receptor beta (5195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2335AlogP: 3.21#Rotatable Bonds: 8
Polar Surface Area: 120.09Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.15CX Basic pKa: 6.07CX LogP: 2.91CX LogD: 2.89
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -1.87

References

1. Chen X, Liu L, Liu P, Chen Y, Lin D, Yan H, Yan Q, Wang Y, Qiu Y, Fang B, Huang H, Qian J, Zhao Y, Du Z, Zhang Q, Li X, Zheng X, Liu Z..  (2022)  Discovery of Potent and Orally Bioavailable Platelet-Derived Growth Factor Receptor (PDGFR) Inhibitors for the Treatment of Osteosarcoma.,  65  (7.0): [PMID:35239349] [10.1021/acs.jmedchem.1c01732]

Source