The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-chlorophenyl)-N-(diphenylmethyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide ID: ALA5206778
PubChem CID: 168295669
Max Phase: Preclinical
Molecular Formula: C28H20ClN3O2
Molecular Weight: 465.94
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(c1ccccc1)c1ccccc1)c1nn(-c2ccc(Cl)cc2)c(=O)c2ccccc12
Standard InChI: InChI=1S/C28H20ClN3O2/c29-21-15-17-22(18-16-21)32-28(34)24-14-8-7-13-23(24)26(31-32)27(33)30-25(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-18,25H,(H,30,33)
Standard InChI Key: AHWYXQOZGKLVRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-2.8557 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1411 -0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1394 -2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 -1.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 -0.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 -1.6499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -2.8876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1412 -2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1412 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4309 -3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 -2.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8557 -3.3000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 0.8254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 0.8254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7143 2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 2.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4274 3.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1422 2.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 2.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4320 1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4294 1.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1415 2.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4313 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 2.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
10 11 2 0
9 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
7 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
25 23 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
23 29 1 0
30 24 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
24 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.94Molecular Weight (Monoisotopic): 465.1244AlogP: 5.56#Rotatable Bonds: 5Polar Surface Area: 63.99Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.93CX Basic pKa: ┄CX LogP: 6.21CX LogD: 6.21Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.47
References 1. Shi W, Zhang P, Zou F, Zhou J, Yin Z, Cai Z, Ghaleb H, Jiang Y, Huang W, Liu Y, Qiu Q, Qian H.. (2022) Exploration of novel phthalazinone derivatives as potential efflux transporter inhibitors for reversing multidrug resistance and improving the oral absorption of paclitaxel., 233 [PMID:35247755 ] [10.1016/j.ejmech.2022.114231 ]