3-(Bis(2-(pivaloylthio)ethoxy)phosphoryl)-2-oxopiperidin-1-yl Acetate

ID: ALA5207017

PubChem CID: 166450640

Max Phase: Preclinical

Molecular Formula: C21H36NO8PS2

Molecular Weight: 525.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)ON1CCCC(P(=O)(OCCSC(=O)C(C)(C)C)OCCSC(=O)C(C)(C)C)C1=O

Standard InChI:  InChI=1S/C21H36NO8PS2/c1-15(23)30-22-10-8-9-16(17(22)24)31(27,28-11-13-32-18(25)20(2,3)4)29-12-14-33-19(26)21(5,6)7/h16H,8-14H2,1-7H3

Standard InChI Key:  JURRWCVRTCUNTB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 33  0  0  0  0  0  0  0  0999 V2000
    1.3033   -2.0484    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.3033   -1.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5889   -0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5889    0.0141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1254    0.4266    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.2877    1.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1128    1.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5251    1.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3504    1.8571    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7631    2.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5882    2.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0006    3.2862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0006    1.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4132    2.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3504    3.2862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5372    1.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8401    0.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5547    0.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5547    1.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2696    0.0141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2696   -0.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5547   -1.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8401   -0.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9841    0.4266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6987    0.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4132    0.4266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6987   -0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0181   -2.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0181   -3.2862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7327   -2.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7327   -1.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4472   -2.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4472   -1.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
 11 14  1  0
 10 15  2  0
  5 16  2  0
 17  5  1  0
 17 18  1  0
 18 19  2  0
 20 18  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 17  1  0
 20 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
  1 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207017

    ---

Associated Targets(Human)

D-423MG (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.63Molecular Weight (Monoisotopic): 525.1620AlogP: 4.29#Rotatable Bonds: 10
Polar Surface Area: 116.28Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.02CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: 0.04

References

1. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL..  (2022)  Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1-Deleted Cancers.,  65  (20.0): [PMID:36251833] [10.1021/acs.jmedchem.2c01039]

Source