The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(Bis(2-(pivaloylthio)ethoxy)phosphoryl)-2-oxopiperidin-1-yl Acetate ID: ALA5207017
PubChem CID: 166450640
Max Phase: Preclinical
Molecular Formula: C21H36NO8PS2
Molecular Weight: 525.63
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)ON1CCCC(P(=O)(OCCSC(=O)C(C)(C)C)OCCSC(=O)C(C)(C)C)C1=O
Standard InChI: InChI=1S/C21H36NO8PS2/c1-15(23)30-22-10-8-9-16(17(22)24)31(27,28-11-13-32-18(25)20(2,3)4)29-12-14-33-19(26)21(5,6)7/h16H,8-14H2,1-7H3
Standard InChI Key: JURRWCVRTCUNTB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
1.3033 -2.0484 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3033 -1.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5889 -0.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5889 0.0141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1254 0.4266 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
0.2877 1.1425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1128 1.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5251 1.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3504 1.8571 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7631 2.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5882 2.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0006 3.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0006 1.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4132 2.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3504 3.2862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5372 1.1425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8401 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5547 0.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5547 1.2519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2696 0.0141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2696 -0.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5547 -1.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8401 -0.8110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9841 0.4266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6987 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4132 0.4266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6987 -0.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0181 -2.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0181 -3.2862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7327 -2.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7327 -1.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4472 -2.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4472 -1.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
10 15 2 0
5 16 2 0
17 5 1 0
17 18 1 0
18 19 2 0
20 18 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 17 1 0
20 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
1 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.63Molecular Weight (Monoisotopic): 525.1620AlogP: 4.29#Rotatable Bonds: 10Polar Surface Area: 116.28Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.02CX Basic pKa: ┄CX LogP: 3.58CX LogD: 3.58Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: 0.04
References 1. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL.. (2022) Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1 -Deleted Cancers., 65 (20.0): [PMID:36251833 ] [10.1021/acs.jmedchem.2c01039 ]