(2S)-2-amino-4-[[4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2-oxo-pyrimidin-5-yl]methylamino]butanoic acid

ID: ALA5207209

PubChem CID: 168297433

Max Phase: Preclinical

Molecular Formula: C14H23N5O6

Molecular Weight: 357.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1CNCC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C14H23N5O6/c15-8(13(22)23)1-2-17-4-7-5-19(14(24)18-12(7)16)11-3-9(21)10(6-20)25-11/h5,8-11,17,20-21H,1-4,6,15H2,(H,22,23)(H2,16,18,24)/t8-,9-,10+,11+/m0/s1

Standard InChI Key:  RSZJXFKNJBHJCQ-UKKRHICBSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   -1.5863    1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8718    1.6777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1573    1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1573    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8718    0.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5863    0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3005    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3867   -0.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1931   -0.9634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6053   -0.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0536    0.3630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4300   -0.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8424   -0.9638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6054   -1.6777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5568    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2710    0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9853    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6996    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5568    1.6775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3005    1.6775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4138    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1281    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4138   -0.7969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1281    1.2649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8424    0.0278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  1  0
  7  6  1  1
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 10 12  1  1
 12 13  1  0
  9 14  1  6
  4 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  3 19  1  0
  1 20  2  0
 18 21  1  0
 21 22  1  0
 21 23  1  1
 22 24  2  0
 22 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207209

    ---

Associated Targets(Human)

DNMT1 Tclin DNA (cytosine-5)-methyltransferase 1 (978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.37Molecular Weight (Monoisotopic): 357.1648AlogP: -2.64#Rotatable Bonds: 8
Polar Surface Area: 185.95Molecular Species: ZWITTERIONHBA: 10HBD: 6
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.77CX Basic pKa: 9.19CX LogP: -5.82CX LogD: -5.85
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.27Np Likeness Score: 0.96

References

1. Lamiable-Oulaidi F, Harijan RK, Shaffer KJ, Crump DR, Sun Y, Du Q, Gulab SA, Khan AA, Luxenburger A, Woolhouse AD, Sidoli S, Tyler PC, Schramm VL..  (2022)  Synthesis and Characterization of Transition-State Analogue Inhibitors against Human DNA Methyltransferase 1.,  65  (7.0): [PMID:35324190] [10.1021/acs.jmedchem.1c01869]

Source