2-[(8-hydroxy-7-quinolyl)methyl]-3,4-dihydro-1H-isoquinoline-6,7-diol

ID: ALA5207286

PubChem CID: 168295899

Max Phase: Preclinical

Molecular Formula: C19H18N2O3

Molecular Weight: 322.36

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1cc2c(cc1O)CN(Cc1ccc3cccnc3c1O)CC2

Standard InChI:  InChI=1S/C19H18N2O3/c22-16-8-13-5-7-21(11-15(13)9-17(16)23)10-14-4-3-12-2-1-6-20-18(12)19(14)24/h1-4,6,8-9,22-24H,5,7,10-11H2

Standard InChI Key:  CGFGCVARRDNPQV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -2.1385   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4239    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7120   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7120   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4221   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1385   -1.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4221   -2.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8540   -1.4469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5718   -1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5736   -0.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8591    0.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0025   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7172   -1.0307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7172   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318    0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1464   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1464   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4323    1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1470    1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8589    1.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8640    0.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1470    2.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5736    1.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  6  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  1 11  1  0
  4 12  1  0
 12 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 15 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 16 22  1  0
 20 23  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207286

    ---

Associated Targets(Human)

MES-SA (905 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MES-SA/Dx5 (643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.36Molecular Weight (Monoisotopic): 322.1317AlogP: 2.91#Rotatable Bonds: 2
Polar Surface Area: 76.82Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.47CX Basic pKa: 8.39CX LogP: 2.37CX LogD: 2.24
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -0.61

References

1. Pape VFS, Palkó R, Tóth S, Szabó MJ, Sessler J, Dormán G, Enyedy ÉA, Soós T, Szatmári I, Szakács G..  (2022)  Structure-Activity Relationships of 8-Hydroxyquinoline-Derived Mannich Bases with Tertiary Amines Targeting Multidrug-Resistant Cancer.,  65  (11.0): [PMID:35613553] [10.1021/acs.jmedchem.2c00076]

Source