Diethyl ((E)-3-([1,1'-biphenyl]-3-yl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5207301

PubChem CID: 168296279

Max Phase: Preclinical

Molecular Formula: C31H39N3O7

Molecular Weight: 565.67

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cccc(-c2ccccc2)c1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C31H39N3O7/c1-5-40-28(37)18-16-25(31(39)41-6-2)33-30(38)29(21(3)4)34-27(36)20-32-26(35)17-15-22-11-10-14-24(19-22)23-12-8-7-9-13-23/h7-15,17,19,21,25,29H,5-6,16,18,20H2,1-4H3,(H,32,35)(H,33,38)(H,34,36)/b17-15+/t25-,29+/m1/s1

Standard InChI Key:  HBLBEKAHNNPGCB-QEALHERHSA-N

Molfile:  

 
     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
   -2.1643    0.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4498    0.8613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1643   -0.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8789    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5935    0.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3082    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0230    0.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7352    0.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7352    1.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0248    2.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3082    1.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7352    0.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0205    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6941    0.4486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0205    1.6865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4087    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1233    0.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4087    1.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8380    0.8613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1233   -0.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5526    0.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2673    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9819    0.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6966    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4112    0.4486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1259    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5526   -0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2673   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8380   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2673   -1.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6000   -2.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8793    0.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6966    1.6865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1233    2.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6941    2.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4498    0.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4501   -0.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1629   -0.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8778   -0.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8793    0.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1675    0.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 16 18  1  1
 17 19  1  0
 17 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  6
 27 28  1  0
 27 29  2  0
 28 30  1  0
 31 30  1  0
 32 26  1  0
 24 33  2  0
 34 18  1  0
 18 35  1  0
  8 36  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 40 39  1  0
 41 40  2  0
 36 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207301

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.67Molecular Weight (Monoisotopic): 565.2788AlogP: 3.02#Rotatable Bonds: 15
Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.95CX Basic pKa: CX LogP: 3.14CX LogD: 3.14
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: -0.35

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source