The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,4E)-5-(3-Methoxyphenyl)-2-phenyl-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one ID: ALA5207366
PubChem CID: 168294325
Max Phase: Preclinical
Molecular Formula: C26H26N4O2
Molecular Weight: 426.52
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(/C=C/C=C(/C(=O)N2CCN(c3ncccn3)CC2)c2ccccc2)c1
Standard InChI: InChI=1S/C26H26N4O2/c1-32-23-12-5-8-21(20-23)9-6-13-24(22-10-3-2-4-11-22)25(31)29-16-18-30(19-17-29)26-27-14-7-15-28-26/h2-15,20H,16-19H2,1H3/b9-6+,24-13+
Standard InChI Key: YKVDEVISMRSZLH-VNXHVWHNSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-3.2152 -1.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4979 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4979 -2.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9276 -2.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9276 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 -1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 -0.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0779 0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0779 1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3655 1.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3655 2.2711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3492 1.0373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0675 1.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7861 1.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7861 0.2133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0748 -0.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3492 0.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 -0.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 -1.0248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2158 -1.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9306 -1.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9306 -0.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2158 0.2218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7928 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7928 2.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5076 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2224 2.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2224 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5076 1.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2146 -3.5062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9300 -3.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 2 0
13 11 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
19 16 1 0
20 19 2 0
20 21 1 0
22 21 2 0
23 22 1 0
19 24 1 0
24 23 2 0
25 10 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
4 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2056AlogP: 3.93#Rotatable Bonds: 6Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.20CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.92
References 1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J.. (2022) Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents., 231 [PMID:35123296 ] [10.1016/j.ejmech.2022.114151 ]