(2E,4E)-5-(3-Methoxyphenyl)-2-phenyl-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one

ID: ALA5207366

PubChem CID: 168294325

Max Phase: Preclinical

Molecular Formula: C26H26N4O2

Molecular Weight: 426.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(/C=C/C=C(/C(=O)N2CCN(c3ncccn3)CC2)c2ccccc2)c1

Standard InChI:  InChI=1S/C26H26N4O2/c1-32-23-12-5-8-21(20-23)9-6-13-24(22-10-3-2-4-11-22)25(31)29-16-18-30(19-17-29)26-27-14-7-15-28-26/h2-15,20H,16-19H2,1H3/b9-6+,24-13+

Standard InChI Key:  YKVDEVISMRSZLH-VNXHVWHNSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -3.2152   -1.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4979   -1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4979   -2.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2127   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9276   -2.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9276   -1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7879   -1.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7879   -0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0779    0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0779    1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3655    1.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3655    2.2711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3492    1.0373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0675    1.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    1.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    0.2133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0748   -0.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3492    0.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5010   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5010   -1.0248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2158   -1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306   -1.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2158    0.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7928    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7928    2.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5076    2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2224    2.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2224    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5076    1.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -3.5062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9300   -3.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 19 16  1  0
 20 19  2  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
 25 10  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  4 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207366

    ---

Associated Targets(non-human)

HT-22 (3261 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2056AlogP: 3.93#Rotatable Bonds: 6
Polar Surface Area: 58.56Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.20CX LogP: 4.31CX LogD: 4.31
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.92

References

1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J..  (2022)  Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents.,  231  [PMID:35123296] [10.1016/j.ejmech.2022.114151]

Source