The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(2-fluorophenyl)-4-oxothiazolidin-2-yl)-N-(4-phenylbutyl)benzamide ID: ALA5207409
PubChem CID: 168295707
Max Phase: Preclinical
Molecular Formula: C26H25FN2O2S
Molecular Weight: 448.56
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCCc1ccccc1)c1cccc(C2SCC(=O)N2c2ccccc2F)c1
Standard InChI: InChI=1S/C26H25FN2O2S/c27-22-14-4-5-15-23(22)29-24(30)18-32-26(29)21-13-8-12-20(17-21)25(31)28-16-7-6-11-19-9-2-1-3-10-19/h1-5,8-10,12-15,17,26H,6-7,11,16,18H2,(H,28,31)
Standard InChI Key: QSVLXPIKZBPZLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-0.6288 -2.5148 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.4145 -2.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5880 -1.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9766 -0.9071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1693 -1.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1674 -1.8305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2420 -0.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3110 0.2499 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0641 -0.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7798 0.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7798 1.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4980 1.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4980 2.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2162 2.7972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7872 2.8014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0715 2.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 2.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 2.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0706 2.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7863 2.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4956 2.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 2.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2162 1.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5019 1.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7863 1.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2099 1.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2099 0.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4963 -0.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3736 -1.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9855 -1.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8129 -2.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0230 -2.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 3 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
10 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
20 25 2 0
12 26 1 0
26 27 2 0
27 28 1 0
28 10 2 0
3 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 2 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.56Molecular Weight (Monoisotopic): 448.1621AlogP: 5.36#Rotatable Bonds: 8Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.30CX LogD: 5.30Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.13
References 1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S.. (2022) Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo., 228 [PMID:34861640 ] [10.1016/j.ejmech.2021.114010 ]