The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-5-guanidino-1-hydroxypentan-2-yl)-2-((R)-2-hydroxy-3-phenylpropanamido)-4-phenylbutanamide ID: ALA5207595
PubChem CID: 168010307
Max Phase: Preclinical
Molecular Formula: C25H35N5O6
Molecular Weight: 501.58
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](CO)NC(=O)[C@H](CCc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1
Standard InChI: InChI=1S/C25H35N5O6/c26-25(27)28-13-1-2-18(15-31)29-23(35)21(12-7-16-3-8-19(32)9-4-16)30-24(36)22(34)14-17-5-10-20(33)11-6-17/h3-6,8-11,18,21-22,31-34H,1-2,7,12-15H2,(H,29,35)(H,30,36)(H4,26,27,28)/t18-,21-,22+/m0/s1
Standard InChI Key: KUDMTGKUAJSKRF-YUXAGFNASA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
-4.6437 2.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9291 3.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6437 1.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5026 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 2.6808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 0.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 -1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7843 -1.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0694 -2.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3575 -1.8590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3528 -1.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 2.6808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 1.4430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 3.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9290 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9290 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 0.6178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3583 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3583 3.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0694 -3.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
9 11 1 0
9 12 2 0
11 13 1 0
13 14 1 0
13 15 1 6
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
14 23 2 0
14 24 1 0
24 25 1 0
25 26 1 0
25 27 1 1
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
26 34 1 0
1 35 1 0
20 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.58Molecular Weight (Monoisotopic): 501.2587AlogP: -0.14#Rotatable Bonds: 14Polar Surface Area: 201.02Molecular Species: BASEHBA: 7HBD: 9#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.20CX Basic pKa: 11.91CX LogP: -0.41CX LogD: -1.60Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.10Np Likeness Score: 0.78
References 1. Phan CS, Mehjabin JJ, Anas ARJ, Hayasaka M, Onoki R, Wang J, Umezawa T, Washio K, Morikawa M, Okino T.. (2022) Nostosin G and Spiroidesin B from the Cyanobacterium Dolichospermum sp. NIES-1697., 85 (8.0): [PMID:35948062 ] [10.1021/acs.jnatprod.2c00382 ]