(S)-N-((S)-5-guanidino-1-hydroxypentan-2-yl)-2-((R)-2-hydroxy-3-phenylpropanamido)-4-phenylbutanamide

ID: ALA5207595

PubChem CID: 168010307

Max Phase: Preclinical

Molecular Formula: C25H35N5O6

Molecular Weight: 501.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H](CO)NC(=O)[C@H](CCc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1

Standard InChI:  InChI=1S/C25H35N5O6/c26-25(27)28-13-1-2-18(15-31)29-23(35)21(12-7-16-3-8-19(32)9-4-16)30-24(36)22(34)14-17-5-10-20(33)11-6-17/h3-6,8-11,18,21-22,31-34H,1-2,7,12-15H2,(H,29,35)(H,30,36)(H4,26,27,28)/t18-,21-,22+/m0/s1

Standard InChI Key:  KUDMTGKUAJSKRF-YUXAGFNASA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   -4.6437    2.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291    3.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2172    2.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2172    1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9273    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6437    1.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5026    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7879    1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7879    2.6808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3587    1.8556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0733    0.6178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705    1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705    0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705   -0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7843   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0694   -2.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3575   -1.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3528   -1.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705    2.6808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851    1.4430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    2.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    3.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    2.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    1.8556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6437    1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6437    0.6178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3583    1.8556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.6178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3583    3.0930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0694   -3.0933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  1
  9 11  1  0
  9 12  2  0
 11 13  1  0
 13 14  1  0
 13 15  1  6
 15 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 14 23  2  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  1
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 26 34  1  0
  1 35  1  0
 20 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207595

    ---

Associated Targets(Human)

PRSS1 Tclin Trypsin (2137 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.58Molecular Weight (Monoisotopic): 501.2587AlogP: -0.14#Rotatable Bonds: 14
Polar Surface Area: 201.02Molecular Species: BASEHBA: 7HBD: 9
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 10#RO5 Violations (Lipinski): 3
CX Acidic pKa: 9.20CX Basic pKa: 11.91CX LogP: -0.41CX LogD: -1.60
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.10Np Likeness Score: 0.78

References

1. Phan CS, Mehjabin JJ, Anas ARJ, Hayasaka M, Onoki R, Wang J, Umezawa T, Washio K, Morikawa M, Okino T..  (2022)  Nostosin G and Spiroidesin B from the Cyanobacterium Dolichospermum sp. NIES-1697.,  85  (8.0): [PMID:35948062] [10.1021/acs.jnatprod.2c00382]

Source