2-Bromo-N-(4-(5-(3-morpholinopropyl)-2,3,4,5-tetrahydro-1H-benzo[b](1,4)diazepine-1-carbonyl)phenyl)benzamide

ID: ALA5207597

PubChem CID: 168294940

Max Phase: Preclinical

Molecular Formula: C30H33BrN4O3

Molecular Weight: 577.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(C(=O)N2CCCN(CCCN3CCOCC3)c3ccccc32)cc1)c1ccccc1Br

Standard InChI:  InChI=1S/C30H33BrN4O3/c31-26-8-2-1-7-25(26)29(36)32-24-13-11-23(12-14-24)30(37)35-18-6-17-34(27-9-3-4-10-28(27)35)16-5-15-33-19-21-38-22-20-33/h1-4,7-14H,5-6,15-22H2,(H,32,36)

Standard InChI Key:  GZDZYBRPQIZKAC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -3.5478    0.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5478   -0.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8334   -0.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1189   -0.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4739   -0.6088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6574   -1.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4458   -1.6564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0527   -1.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2362   -2.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6315   -3.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1568   -3.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7615   -3.6577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5499   -3.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7335   -2.6102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1547   -3.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9711   -4.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5759   -5.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3642   -5.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5478   -4.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9430   -3.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1266   -2.9282    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.3403   -2.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2643   -1.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6695   -0.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3116    0.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6695    1.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4739    1.2448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6574    2.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0527    2.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2362    3.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6315    3.9758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1568    3.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7615    4.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5780    5.0980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2103    5.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8150    4.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1189    0.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8334    1.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 20 15  2  0
 19 20  1  0
 20 21  1  0
 11 22  2  0
 22 23  1  0
 23  8  2  0
  5 24  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 31  1  0
 37 27  1  0
  4 37  2  0
 37 38  1  0
 38  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5207597

    ---

Associated Targets(Human)

AVPR2 Tclin Vasopressin V2 receptor (2912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 577.52Molecular Weight (Monoisotopic): 576.1736AlogP: 5.28#Rotatable Bonds: 7
Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.11CX LogP: 4.65CX LogD: 4.47
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: -1.66

References

1. Cao X, Wang P, Yuan H, Zhang H, He Y, Fu K, Fang Q, Liu H, Su L, Yin L, Xu P, Xie Y, Xiong X, Wang J, Zhu X, Guo D..  (2022)  Benzodiazepine Derivatives as Potent Vasopressin V2 Receptor Antagonists for the Treatment of Autosomal Dominant Kidney Disease.,  65  (13.0): [PMID:35579344] [10.1021/acs.jmedchem.2c00567]

Source