The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((benzo[d]thiazol-2-ylamino)methyl)-5,8-dimethoxynaphthalene-1,4-dione ID: ALA5207622
PubChem CID: 142711867
Max Phase: Preclinical
Molecular Formula: C20H16N2O4S
Molecular Weight: 380.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c2c1C(=O)C=C(CNc1nc3ccccc3s1)C2=O
Standard InChI: InChI=1S/C20H16N2O4S/c1-25-14-7-8-15(26-2)18-17(14)13(23)9-11(19(18)24)10-21-20-22-12-5-3-4-6-16(12)27-20/h3-9H,10H2,1-2H3,(H,21,22)
Standard InChI Key: DILGDMOUKUCQQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
-3.7698 0.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0553 1.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3409 0.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3409 -0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0553 -0.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7698 -0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6283 1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9135 0.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9117 -0.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6232 -0.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0553 1.8838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0553 -1.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6283 1.8821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6232 -1.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1975 -0.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5166 -0.1758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2309 -0.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9839 -0.2528 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5355 -0.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1233 -1.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3170 -1.4079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3573 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7698 -1.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3612 -2.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5375 -2.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7696 2.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3411 -1.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 2 0
1 6 2 0
6 5 1 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
2 11 1 0
5 12 1 0
7 13 2 0
10 14 2 0
9 15 1 0
15 16 1 0
16 17 1 0
18 17 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 2 0
19 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
11 26 1 0
12 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.43Molecular Weight (Monoisotopic): 380.0831AlogP: 3.73#Rotatable Bonds: 5Polar Surface Area: 77.52Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.22CX LogP: 3.08CX LogD: 3.08Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -0.32
References 1. Valipour M.. (2022) Recent advances of antitumor shikonin/alkannin derivatives: A comprehensive overview focusing on structural classification, synthetic approaches, and mechanisms of action., 235 [PMID:35367708 ] [10.1016/j.ejmech.2022.114314 ]