(5S,8R,9R,10S)-2S-Acetoxy-6S-methoxyclerod-3,12,14-trien-18,19-dial

ID: ALA5207698

PubChem CID: 168297685

Max Phase: Preclinical

Molecular Formula: C23H32O5

Molecular Weight: 388.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C/C(C)=C/C[C@]1(C)[C@H](C)C[C@H](OC)[C@@]2(C=O)C(C=O)=C[C@@H](OC(C)=O)C[C@@H]12

Standard InChI:  InChI=1S/C23H32O5/c1-7-15(2)8-9-22(5)16(3)10-21(27-6)23(14-25)18(13-24)11-19(12-20(22)23)28-17(4)26/h7-8,11,13-14,16,19-21H,1,9-10,12H2,2-6H3/b15-8+/t16-,19-,20+,21+,22-,23+/m1/s1

Standard InChI Key:  ARJHGCLNBKFDTE-CNRADSBNSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
   -1.3885    0.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740    0.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0403    0.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0403   -0.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3885   -0.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6740   -2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3887   -2.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7547   -1.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4691   -0.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4691    0.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7547    0.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7547    1.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4694    1.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2946    1.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7072    2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5324    2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7072    0.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4694    0.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1838    0.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7547   -2.0075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0403   -1.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3721   -2.3096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0403    0.8803    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1031    0.4677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8177    0.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5324    0.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8177   -0.7700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4694   -2.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 15 18  1  0
 12 19  1  1
 11 20  1  6
  9 21  1  6
  4 22  1  6
 22 23  2  0
  3 24  1  6
  1 25  1  1
 25 26  1  0
 26 27  1  0
 26 28  2  0
 21 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207698

    ---

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; alpha-1/beta-2/gamma-2 (1171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.50Molecular Weight (Monoisotopic): 388.2250AlogP: 3.83#Rotatable Bonds: 7
Polar Surface Area: 69.67Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.77CX LogD: 2.77
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.38Np Likeness Score: 3.42

References

1. Syafni N, Faleschini MT, Garifulina A, Danton O, Gupta MP, Hering S, Hamburger M..  (2022)  Clerodane Diterpenes from Casearia corymbosa as Allosteric GABAA Receptor Modulators.,  85  (5.0): [PMID:35475609] [10.1021/acs.jnatprod.1c00840]

Source