Diethyl (6-bromobenzofuran-2-carbonyl)glycyl-L-valyl-D-glutamate

ID: ALA5207716

PubChem CID: 168294336

Max Phase: Preclinical

Molecular Formula: C27H34BrN3O8

Molecular Weight: 608.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cc2ccc(Br)cc2o1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C27H34BrN3O8/c1-5-37-24(34)12-10-20(27(36)38-6-2)30-26(35)25(16(3)4)31-23(33)15-29-22(32)11-9-19-13-17-7-8-18(28)14-21(17)39-19/h7-9,11,13-14,16,20,25H,5-6,10,12,15H2,1-4H3,(H,29,32)(H,30,35)(H,31,33)/b11-9+/t20-,25+/m1/s1

Standard InChI Key:  QYPKHASLHLIIMW-CYFZQZRSSA-N

Molfile:  

 
     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   -2.6779   -0.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9634    0.2708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6779   -0.9669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3926    0.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1073   -0.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8220    0.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2487   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5340    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1806   -0.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5340    1.0961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8953    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6100   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8953    1.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3247    0.2708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6100   -0.9670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0394   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7541    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4688   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1835    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8982   -0.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6129    0.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0394   -0.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7541   -1.3797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3247   -1.3797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7541   -2.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0868   -2.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3665   -0.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1835    1.0961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6100    1.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1806    1.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5755   -0.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1275    0.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7151    1.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9082    1.0912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9499    0.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3626    1.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9538    1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1295    1.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3665    2.6897    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  1
 12 14  1  0
 12 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  6
 22 23  1  0
 22 24  2  0
 23 25  1  0
 26 25  1  0
 27 21  1  0
 19 28  2  0
 29 13  1  0
 13 30  1  0
 31  6  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34  6  1  0
 32 35  1  0
 36 35  2  0
 37 36  1  0
 38 37  2  0
 33 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207716

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 608.49Molecular Weight (Monoisotopic): 607.1529AlogP: 2.86#Rotatable Bonds: 14
Polar Surface Area: 153.04Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.77CX Basic pKa: CX LogP: 2.35CX LogD: 2.35
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -0.34

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source