The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl (6-bromobenzofuran-2-carbonyl)glycyl-L-valyl-D-glutamate ID: ALA5207716
PubChem CID: 168294336
Max Phase: Preclinical
Molecular Formula: C27H34BrN3O8
Molecular Weight: 608.49
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cc2ccc(Br)cc2o1)C(C)C)C(=O)OCC
Standard InChI: InChI=1S/C27H34BrN3O8/c1-5-37-24(34)12-10-20(27(36)38-6-2)30-26(35)25(16(3)4)31-23(33)15-29-22(32)11-9-19-13-17-7-8-18(28)14-21(17)39-19/h7-9,11,13-14,16,20,25H,5-6,10,12,15H2,1-4H3,(H,29,32)(H,30,35)(H,31,33)/b11-9+/t20-,25+/m1/s1
Standard InChI Key: QYPKHASLHLIIMW-CYFZQZRSSA-N
Molfile:
RDKit 2D
39 40 0 0 0 0 0 0 0 0999 V2000
-2.6779 -0.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9634 0.2708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6779 -0.9669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3926 0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1073 -0.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8220 0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2487 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5340 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1806 -0.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5340 1.0961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8953 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6100 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8953 1.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3247 0.2708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6100 -0.9670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0394 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7541 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4688 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1835 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8982 -0.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6129 0.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0394 -0.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7541 -1.3797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3247 -1.3797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7541 -2.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0868 -2.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3665 -0.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1835 1.0961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6100 1.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1806 1.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5755 -0.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1275 0.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7151 1.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9082 1.0912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.9499 0.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3626 1.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9538 1.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1295 1.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3665 2.6897 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
11 13 1 1
12 14 1 0
12 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 22 1 6
22 23 1 0
22 24 2 0
23 25 1 0
26 25 1 0
27 21 1 0
19 28 2 0
29 13 1 0
13 30 1 0
31 6 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 6 1 0
32 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
33 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 608.49Molecular Weight (Monoisotopic): 607.1529AlogP: 2.86#Rotatable Bonds: 14Polar Surface Area: 153.04Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.77CX Basic pKa: ┄CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -0.34