The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[4-hydroxy-1-methoxy-7-(4-phenoxyphenoxy)isoquinoline-3-carbonyl]amino]acetic acid ID: ALA5207720
PubChem CID: 163321764
Max Phase: Preclinical
Molecular Formula: C25H20N2O7
Molecular Weight: 460.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1nc(C(=O)NCC(=O)O)c(O)c2ccc(Oc3ccc(Oc4ccccc4)cc3)cc12
Standard InChI: InChI=1S/C25H20N2O7/c1-32-25-20-13-18(11-12-19(20)23(30)22(27-25)24(31)26-14-21(28)29)34-17-9-7-16(8-10-17)33-15-5-3-2-4-6-15/h2-13,30H,14H2,1H3,(H,26,31)(H,28,29)
Standard InChI Key: NUAFQTOBMYYSNS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-0.3561 0.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3584 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 0.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 -0.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3602 -0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3561 -0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7830 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4979 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4997 -0.2022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7881 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7830 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 1.8566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9271 0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6418 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0710 1.0314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 -0.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0707 -0.6210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 -0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 -0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2123 -0.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2123 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5020 1.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 0.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7881 -1.4440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5027 -1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9269 1.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6415 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6418 -0.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3546 -0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0695 -0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0710 0.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3593 1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
7 11 1 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
6 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
10 26 1 0
26 27 1 0
23 28 1 0
28 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.44Molecular Weight (Monoisotopic): 460.1271AlogP: 4.35#Rotatable Bonds: 8Polar Surface Area: 127.21Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.09CX Basic pKa: 1.65CX LogP: 4.25CX LogD: 0.92Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.29
References 1. Li Q, Yao B, Zhao S, Lu Z, Zhang Y, Xiang Q, Wu X, Yu H, Zhang C, Li J, Zhuang X, Wu D, Li Y, Xu Y.. (2022) Discovery of a Highly Selective and H435R-Sensitive Thyroid Hormone Receptor β Agonist., 65 (10.0): [PMID:35507418 ] [10.1021/acs.jmedchem.2c00144 ]