2-(((2S,3S)-3-((S)-1-(3,5-Dichlorophenyl)-2-hydroxyethoxy)-2-phenylpiperidin-1-yl)methyl)-1H-benzo(d)imidazole-6-carboxylic Acid

ID: ALA5207745

PubChem CID: 168294949

Max Phase: Preclinical

Molecular Formula: C28H27Cl2N3O4

Molecular Weight: 540.45

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc2nc(CN3CCC[C@H](O[C@H](CO)c4cc(Cl)cc(Cl)c4)[C@@H]3c3ccccc3)[nH]c2c1

Standard InChI:  InChI=1S/C28H27Cl2N3O4/c29-20-11-19(12-21(30)14-20)25(16-34)37-24-7-4-10-33(27(24)17-5-2-1-3-6-17)15-26-31-22-9-8-18(28(35)36)13-23(22)32-26/h1-3,5-6,8-9,11-14,24-25,27,34H,4,7,10,15-16H2,(H,31,32)(H,35,36)/t24-,25+,27-/m0/s1

Standard InChI Key:  SSOFDNCUHHHDAD-WEWMWRJBSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -0.1018   -1.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1019   -0.2882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8162    0.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8162    0.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1019    1.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6125    0.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3269    1.3615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3269    2.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6125    2.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1019    2.1865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    2.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    3.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7557    3.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7557    4.6612    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.4702    3.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4702    2.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1845    2.1865    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.7557    2.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6125    0.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3269   -0.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3269   -1.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7557   -1.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7557   -0.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    0.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8162   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9025   -2.3461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7094   -2.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1218   -1.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9467   -1.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9467   -3.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1218   -3.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5698   -1.1901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3592   -2.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3593   -3.9466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9467   -4.6612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1845   -3.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  0
  6  5  1  0
  6  7  1  6
  7  8  1  0
  8  9  1  6
  9 10  1  0
  8 11  1  0
 12 11  2  0
 13 12  1  0
 13 14  1  0
 15 13  2  0
 16 15  1  0
 16 17  1  0
 18 16  2  0
 11 18  1  0
 19  6  1  0
  2 19  1  0
 19 20  1  6
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
  1 26  1  0
 27 26  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 28 32  1  0
 31 32  2  0
 29 33  1  0
 33 26  2  0
 30 34  2  0
 34 31  1  0
 31 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5207745

    ---

Associated Targets(Human)

PRKG1 Tchem cGMP-dependent protein kinase 1 beta (2814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.45Molecular Weight (Monoisotopic): 539.1379AlogP: 6.02#Rotatable Bonds: 8
Polar Surface Area: 98.68Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.68CX Basic pKa: 6.70CX LogP: 2.94CX LogD: 2.34
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -0.62

References

1. Mak VW, Patel AM, Yen R, Hanisak J, Lim YH, Bao J, Zheng R, Seganish WM, Yu Y, Healy DR, Ogawa A, Ren Z, Soriano A, Ermakov GP, Beaumont M, Metwally E, Cheng AC, Verras A, Fischmann T, Zebisch M, Silvestre HL, McEwan PA, Barker J, Rearden P, Greshock TJ..  (2022)  Optimization and Mechanistic Investigations of Novel Allosteric Activators of PKG1α.,  65  (15.0): [PMID:35878399] [10.1021/acs.jmedchem.1c02109]

Source