N-(1-hydroxy-2-methylpropan-2-yl)-2-methyl-5-(4-(4-sulfamoylphenylamino)phthalazin-1-yl)benzenesulfonamide

ID: ALA5207807

PubChem CID: 6412419

Max Phase: Preclinical

Molecular Formula: C25H27N5O5S2

Molecular Weight: 541.66

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nnc(Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)cc1S(=O)(=O)NC(C)(C)CO

Standard InChI:  InChI=1S/C25H27N5O5S2/c1-16-8-9-17(14-22(16)37(34,35)30-25(2,3)15-31)23-20-6-4-5-7-21(20)24(29-28-23)27-18-10-12-19(13-11-18)36(26,32)33/h4-14,30-31H,15H2,1-3H3,(H,27,29)(H2,26,32,33)

Standard InChI Key:  ITQAVBNFIDRIBE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    0.2401    3.8045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6520    3.0897    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0647    3.8045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3654    2.6778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0789    3.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    2.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0613    1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    1.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4857    2.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    3.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7720    3.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7731    0.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4846   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7680   -1.8541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0546   -2.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0546   -3.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6607   -3.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -3.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0833   -3.5016    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4960   -2.7886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9086   -3.5016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0833   -4.3254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3699   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6589   -1.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575   -0.6143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0575    0.2052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1935   -1.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9086   -0.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9086    0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1952    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0789    3.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7923    4.3254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2925    2.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8746    2.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  6  2  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
 11 12  1  0
 13  8  1  0
 14 13  1  0
 15 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  2  0
 22 25  1  0
 21 26  2  0
 26 27  1  0
 27 18  2  0
 16 28  2  0
 28 29  1  0
 29 13  2  0
 30 15  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 14 33  1  0
  5 34  1  0
 34 35  1  0
  5 36  1  0
  5 37  1  0
M  END

Associated Targets(Human)

ENPP3 Tchem Ectonucleotide pyrophosphatase/phosphodiesterase family member 3 (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 541.66Molecular Weight (Monoisotopic): 541.1454AlogP: 3.05#Rotatable Bonds: 8
Polar Surface Area: 164.37Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.07CX Basic pKa: 2.97CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.49

References

1. Lee SY, Namasivayam V, Boshta NM, Perotti A, Mirza S, Bua S, Supuran CT, Müller CE..  (2021)  Discovery of potent nucleotide pyrophosphatase/phosphodiesterase3 (NPP3) inhibitors with ancillary carbonic anhydrase inhibition for cancer (immuno)therapy.,  12  (7.0): [PMID:34355184] [10.1039/D1MD00117E]
2. Ahmad, Haseen and 7 more authors.  2020-12-15  Synthesis of biphenyl oxazole derivatives via Suzuki coupling and biological evaluations as nucleotide pyrophosphatase/phosphodiesterase-1 and -3 inhibitors.  [PMID:32883636]

Source