The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[3-[2-(4-ethylpiperazin-1-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-4-fluoro-phenyl]methyl]-2H-phthalazin-1-one ID: ALA5207861
PubChem CID: 168297894
Max Phase: Preclinical
Molecular Formula: C29H30FN7O2
Molecular Weight: 527.60
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(c2ncc3c(n2)CCN(C(=O)c2cc(Cc4n[nH]c(=O)c5ccccc45)ccc2F)C3)CC1
Standard InChI: InChI=1S/C29H30FN7O2/c1-2-35-11-13-36(14-12-35)29-31-17-20-18-37(10-9-25(20)32-29)28(39)23-15-19(7-8-24(23)30)16-26-21-5-3-4-6-22(21)27(38)34-33-26/h3-8,15,17H,2,9-14,16,18H2,1H3,(H,34,38)
Standard InChI Key: WRKBMBVYLZQITM-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-6.0718 1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3572 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6454 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6454 1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3554 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0718 1.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 2.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2160 1.8551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2160 1.0300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 0.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 3.0929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 -0.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2160 -0.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5013 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7892 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7892 -1.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4994 -1.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2160 -1.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 -1.8579 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3599 -0.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3546 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 -1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3546 -1.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3599 -1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7820 -0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4969 -0.6215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4987 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7870 -1.8592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2133 -1.8552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9279 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6426 -1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6426 -2.6803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9279 -3.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2133 -2.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3572 -3.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0718 -2.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
4 10 1 0
7 11 2 0
10 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
15 20 1 0
20 21 2 0
20 22 1 0
23 22 1 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 1 0
22 27 1 0
24 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
25 31 1 0
30 32 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
32 37 1 0
35 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.60Molecular Weight (Monoisotopic): 527.2445AlogP: 2.78#Rotatable Bonds: 5Polar Surface Area: 98.32Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.96CX Basic pKa: 7.49CX LogP: 2.97CX LogD: 2.62Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -1.95
References 1. Lin S, Zhang X, Yu Z, Huang X, Xu J, Liu Y, Wu L.. (2022) Synthesis of novel dual target inhibitors of PARP and EGFR and their antitumor activities in triple negative breast cancers., 61 [PMID:35393219 ] [10.1016/j.bmc.2022.116739 ]