The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(3-Morpholinopropyl)-2,3,4,5-tetrahydro-1H-benzo[b]-(1,4)diazepine-1-carbonyl)phenyl)-(1,1'-bipheny)-2-carboxamide ID: ALA5207885
PubChem CID: 168294659
Max Phase: Preclinical
Molecular Formula: C36H38N4O3
Molecular Weight: 574.73
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCCN(CCCN3CCOCC3)c3ccccc32)cc1)c1ccccc1-c1ccccc1
Standard InChI: InChI=1S/C36H38N4O3/c41-35(32-13-5-4-12-31(32)28-10-2-1-3-11-28)37-30-18-16-29(17-19-30)36(42)40-23-9-22-39(33-14-6-7-15-34(33)40)21-8-20-38-24-26-43-27-25-38/h1-7,10-19H,8-9,20-27H2,(H,37,41)
Standard InChI Key: CPMKYYVRVBLUEY-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
-3.8232 0.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8232 -0.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1087 -0.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3942 -0.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7492 -0.6088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9328 -1.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7211 -1.6564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3280 -1.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5116 -2.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9068 -3.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1185 -3.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4862 -3.6577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2745 -3.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4581 -2.6102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8793 -3.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6957 -4.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3005 -5.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0888 -5.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2725 -4.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6677 -3.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8513 -2.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6396 -2.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8232 -1.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2184 -1.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4301 -1.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2465 -2.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0650 -2.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5396 -1.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9449 -0.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5869 0.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9448 1.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7492 1.2448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9328 2.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3280 2.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5116 3.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9068 3.9758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1185 3.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4862 4.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3026 5.0980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4857 5.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0904 4.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3942 0.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1087 1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
20 15 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
26 21 2 0
25 26 1 0
11 27 2 0
27 28 1 0
28 8 2 0
5 29 1 0
30 29 1 0
31 30 1 0
32 31 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 36 1 0
42 32 1 0
4 42 2 0
42 43 1 0
43 1 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.73Molecular Weight (Monoisotopic): 574.2944AlogP: 6.19#Rotatable Bonds: 8Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.11CX LogP: 5.52CX LogD: 5.35Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.40
References 1. Cao X, Wang P, Yuan H, Zhang H, He Y, Fu K, Fang Q, Liu H, Su L, Yin L, Xu P, Xie Y, Xiong X, Wang J, Zhu X, Guo D.. (2022) Benzodiazepine Derivatives as Potent Vasopressin V2 Receptor Antagonists for the Treatment of Autosomal Dominant Kidney Disease., 65 (13.0): [PMID:35579344 ] [10.1021/acs.jmedchem.2c00567 ]