7-Benzyl-3-(oxetan-3-ylmethyl)-5,6-diphenyl-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-imine

ID: ALA5207969

PubChem CID: 53497528

Max Phase: Preclinical

Molecular Formula: C29H26N4O

Molecular Weight: 446.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=c1c2c(-c3ccccc3)c(-c3ccccc3)n(Cc3ccccc3)c2ncn1CC1COC1

Standard InChI:  InChI=1S/C29H26N4O/c30-28-26-25(23-12-6-2-7-13-23)27(24-14-8-3-9-15-24)33(17-21-10-4-1-5-11-21)29(26)31-20-32(28)16-22-18-34-19-22/h1-15,20,22,30H,16-19H2

Standard InChI Key:  QIBSIOBLNWPPRN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -2.7934    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0789    1.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3645    0.5976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3645   -0.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6498   -0.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0648   -0.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8496   -0.4826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0631   -1.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4797   -1.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3204   -1.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9001   -2.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6861   -3.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1109   -3.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6931   -2.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3347    0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1597    0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5740   -0.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3985   -0.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8076    0.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3949    0.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5724    0.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8496    0.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0632    1.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8635    1.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0722    2.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4907    3.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6935    3.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4799    2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0648    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6498    1.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6498    1.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0105   -0.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8076    0.0005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5904    0.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  2  0
 15  7  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 16  2  0
 22 15  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 23  2  0
 29 22  1  0
  6 29  2  0
 29 30  1  0
  3 30  1  0
 30 31  2  0
 34  1  1  0
 32  1  1  0
 33 34  1  0
 33 32  1  0
M  END

Associated Targets(Human)

PC-3M (435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2107AlogP: 5.35#Rotatable Bonds: 6
Polar Surface Area: 55.83Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.52CX LogP: 5.28CX LogD: 4.15
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.59

References

1. Frankowski KJ, Patnaik S, Wang C, Southall N, Dutta D, De S, Li D, Dextras C, Lin YH, Bryant-Connah M, Davis D, Wang F, Wachsmuth LM, Shah P, Williams J, Kabir M, Zhu E, Baljinnyam B, Wang A, Xu X, Norton J, Ferrer M, Titus S, Simeonov A, Zheng W, Mathews Griner LA, Jadhav A, Aubé J, Henderson MJ, Rudloff U, Schoenen FJ, Huang S, Marugan JJ..  (2022)  Discovery and Optimization of Pyrrolopyrimidine Derivatives as Selective Disruptors of the Perinucleolar Compartment, a Marker of Tumor Progression toward Metastasis.,  65  (12.0): [PMID:35696646] [10.1021/acs.jmedchem.2c00204]

Source