5-[(2,6-Difluoro-3,5-dimethoxyphenyl)methoxy]-N-{3-methyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl}pyrimidin-2-amine

ID: ALA5207973

PubChem CID: 71736428

Max Phase: Preclinical

Molecular Formula: C30H38F2N6O3

Molecular Weight: 568.67

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c(F)c(COc2cnc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)c(C)c3)nc2)c1F

Standard InChI:  InChI=1S/C30H38F2N6O3/c1-20-15-21(5-6-25(20)38-9-7-22(8-10-38)37-13-11-36(2)12-14-37)35-30-33-17-23(18-34-30)41-19-24-28(31)26(39-3)16-27(40-4)29(24)32/h5-6,15-18,22H,7-14,19H2,1-4H3,(H,33,34,35)

Standard InChI Key:  CHPINAZPEONSQU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   -2.5002   -0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0738   -0.8236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0738   -1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7839   -2.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002   -1.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591   -2.0614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3554   -1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0685   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7833   -0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7849   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0731   -2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4979   -0.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4979    0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9273    0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9273   -0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126   -0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6418    0.8246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6418    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3565    2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0711    1.6498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0711    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3565    0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7857    2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2149   -0.4115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9296   -0.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6442   -0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3590   -0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3608    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6442    0.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9296    0.8298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3608    1.6506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0754    2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7857   -0.8245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7857   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3590   -1.6491    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4995   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 14 11  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 20 17  1  0
 20 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 20 25  1  0
 23 26  1  0
  1 27  1  0
 27 28  1  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 31 38  1  0
 38 39  1  0
 30 40  1  0
 12 41  1  0
M  END

Associated Targets(Human)

FGFR3 Tclin Fibroblast growth factor receptor 3 (7811 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

NIH3T3 (5395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.67Molecular Weight (Monoisotopic): 568.2973AlogP: 4.62#Rotatable Bonds: 9
Polar Surface Area: 75.22Molecular Species: BASEHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.52CX LogP: 4.20CX LogD: 3.00
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.40Np Likeness Score: -1.19

References

1. Kuriwaki I, Kameda M, Iikubo K, Hisamichi H, Kawamoto Y, Kikuchi S, Moritomo H, Terasaka T, Iwai Y, Noda A, Tomiyama H, Kikuchi A, Hirano M..  (2022)  Discovery of ASP5878: Synthesis and structure-activity relationships of pyrimidine derivatives as pan-FGFRs inhibitors with improved metabolic stability and suppressed hERG channel inhibitory activity.,  59  [PMID:35219181] [10.1016/j.bmc.2022.116657]

Source