The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
pyridin-3-ylmethyl 4-(5-fluoro-2-(pyrrolidin-1-yl)benzamido)benzylcarbamate ID: ALA5208000
PubChem CID: 156781194
Max Phase: Preclinical
Molecular Formula: C25H25FN4O3
Molecular Weight: 448.50
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc(NC(=O)c2cc(F)ccc2N2CCCC2)cc1)OCc1cccnc1
Standard InChI: InChI=1S/C25H25FN4O3/c26-20-7-10-23(30-12-1-2-13-30)22(14-20)24(31)29-21-8-5-18(6-9-21)16-28-25(32)33-17-19-4-3-11-27-15-19/h3-11,14-15H,1-2,12-13,16-17H2,(H,28,32)(H,29,31)
Standard InChI Key: SVGHMALNVGCZNA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-5.7133 1.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9987 1.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2868 1.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2868 0.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9969 -0.1204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7133 0.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5722 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8575 1.1164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 1.1164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 2.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 1.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7158 1.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 1.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7175 -0.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0010 0.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -0.1211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.1166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2865 0.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9987 -0.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9987 -0.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2884 -1.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -1.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7709 -2.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9641 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5517 -1.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1037 -1.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7133 0.2918 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
23 21 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
21 27 1 0
28 27 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
24 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.50Molecular Weight (Monoisotopic): 448.1911AlogP: 4.50#Rotatable Bonds: 7Polar Surface Area: 83.56Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.53CX Basic pKa: 4.75CX LogP: 3.79CX LogD: 3.79Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.79
References 1. Feng Y, Lu Y, Li J, Zhang H, Li Z, Feng H, Deng X, Liu D, Shi T, Jiang W, He Y, Zhang J, Wang Z.. (2022) Design, synthesis and biological evaluation of novel o-aminobenzamide derivatives as potential anti-gastric cancer agents in vitro and in vivo., 227 [PMID:34628244 ] [10.1016/j.ejmech.2021.113888 ]