(R)-1-((1-benzyl-1H-1,2,3-triazol-4-yl)methyl)-3-hydroxy-3-phenylindolin-2-one

ID: ALA5208140

PubChem CID: 168295480

Max Phase: Preclinical

Molecular Formula: C24H20N4O2

Molecular Weight: 396.45

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1N(Cc2cn(Cc3ccccc3)nn2)c2ccccc2[C@]1(O)c1ccccc1

Standard InChI:  InChI=1S/C24H20N4O2/c29-23-24(30,19-11-5-2-6-12-19)21-13-7-8-14-22(21)28(23)17-20-16-27(26-25-20)15-18-9-3-1-4-10-18/h1-14,16,30H,15,17H2/t24-/m1/s1

Standard InChI Key:  UBZVRRZFGRKQHJ-XMMPIXPASA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -3.7103    0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9957    1.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2812    0.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2812   -0.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9957   -0.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7103   -0.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4841   -0.2886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0168    0.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4841    1.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8794    1.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0443    2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4397    2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    2.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5222    1.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0824    1.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6490    1.8551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1923    0.3985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2367   -1.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4397   -1.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1924   -0.6733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9070   -1.0856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7146   -1.9101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0824   -1.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2643   -2.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0888   -2.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6385   -2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4355   -2.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7103   -1.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332   -1.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3362   -1.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  8  7  1  0
  9  8  1  0
  3  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  9 16  1  1
  8 17  2  0
  7 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
 22 24  1  0
 25 24  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 29 28  2  0
 30 29  1  0
 25 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5208140

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.45Molecular Weight (Monoisotopic): 396.1586AlogP: 3.11#Rotatable Bonds: 5
Polar Surface Area: 71.25Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.24CX Basic pKa: 0.03CX LogP: 3.46CX LogD: 3.46
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -0.97

References

1. Busto N, Leitão-Castro J, García-Sosa AT, Cadete F, Marques CS, Freitas R, Burke AJ..  (2022)  N-1,2,3-Triazole-isatin derivatives: anti-proliferation effects and target identification in solid tumour cell lines.,  13  (8.0): [PMID:36092141] [10.1039/d2md00044j]

Source