Diethyl ((E)-3-(4-isopropoxyphenyl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5208149

PubChem CID: 168295740

Max Phase: Preclinical

Molecular Formula: C28H41N3O8

Molecular Weight: 547.65

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(OC(C)C)cc1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C28H41N3O8/c1-7-37-25(34)16-14-22(28(36)38-8-2)30-27(35)26(18(3)4)31-24(33)17-29-23(32)15-11-20-9-12-21(13-10-20)39-19(5)6/h9-13,15,18-19,22,26H,7-8,14,16-17H2,1-6H3,(H,29,32)(H,30,35)(H,31,33)/b15-11+/t22-,26+/m1/s1

Standard InChI Key:  XDKHMUMLLKYJBQ-SBJGAUOOSA-N

Molfile:  

 
     RDKit          2D

 39 39  0  0  0  0  0  0  0  0999 V2000
   -2.5219   -0.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8074    0.2424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5219   -0.9953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2366    0.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9513   -0.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6661    0.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3809   -0.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0931    0.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0931    1.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3827    1.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6661    1.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8078    1.4803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0927   -0.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3780    0.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3366   -0.1702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3780    1.0676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513    0.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660   -0.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513    1.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4807    0.2424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660   -0.9954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1954   -0.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101    0.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6248   -0.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3395    0.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0542   -0.1702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7689    0.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1954   -0.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101   -1.4081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4807   -1.4081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101   -2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2428   -2.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224   -0.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3395    1.0676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660    1.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3366    1.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8078    2.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5224    2.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0931    2.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  9 12  1  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 17 19  1  1
 18 20  1  0
 18 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 22 28  1  6
 28 29  1  0
 28 30  2  0
 29 31  1  0
 32 31  1  0
 33 27  1  0
 25 34  2  0
 35 19  1  0
 19 36  1  0
 12 37  1  0
 37 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5208149

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.65Molecular Weight (Monoisotopic): 547.2894AlogP: 2.14#Rotatable Bonds: 16
Polar Surface Area: 149.13Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.89CX Basic pKa: CX LogP: 2.11CX LogD: 2.11
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.21Np Likeness Score: -0.46

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source