2-(2-chlorophenyl)-5,7-dihydroxy-8-((3R,4R)-4-hydroxy-1-methylpiperidin-3-yl)chroman-4-one

ID: ALA5208357

PubChem CID: 168296336

Max Phase: Preclinical

Molecular Formula: C21H22ClNO5

Molecular Weight: 403.86

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CC[C@@H](O)[C@H](c2c(O)cc(O)c3c2OC(c2ccccc2Cl)CC3=O)C1

Standard InChI:  InChI=1S/C21H22ClNO5/c1-23-7-6-14(24)12(10-23)19-15(25)8-16(26)20-17(27)9-18(28-21(19)20)11-4-2-3-5-13(11)22/h2-5,8,12,14,18,24-26H,6-7,9-10H2,1H3/t12-,14-,18?/m1/s1

Standard InChI Key:  OOPYJTJOYPOYMG-LTPICJTISA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -0.7199    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7199    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0005    1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0005    2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7171    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7171    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0005    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1465    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8585    0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8585   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1483   -1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4318   -0.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4242    1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4242    2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4242    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4242   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448   -1.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1448   -2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4242   -2.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7199   -2.0621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7199   -1.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8585   -0.8232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8573    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1465    1.2374    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.0054   -2.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  3  1  0
  5  6  1  0
  6  7  1  0
  7  1  1  0
  8  6  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
  8 13  1  0
 13 12  2  0
 14  2  1  0
 15 14  1  0
 14 16  2  0
 16 17  1  0
 18  1  1  0
 17 18  2  0
 19 18  1  6
 20 19  1  0
 21 20  1  0
 22 21  1  0
 22 23  1  0
 24 19  1  0
 23 24  1  0
 20 25  1  1
 26 17  1  0
  9 27  1  0
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5208357

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.86Molecular Weight (Monoisotopic): 403.1187AlogP: 3.24#Rotatable Bonds: 2
Polar Surface Area: 90.23Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.19CX Basic pKa: 6.63CX LogP: 2.68CX LogD: 2.73
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: 1.14

References

1. Shi Z, Tian L, Qiang T, Li J, Xing Y, Ren X, Liu C, Liang C..  (2022)  From Structure Modification to Drug Launch: A Systematic Review of the Ongoing Development of Cyclin-Dependent Kinase Inhibitors for Multiple Cancer Therapy.,  65  (9.0): [PMID:35485642] [10.1021/acs.jmedchem.1c02064]

Source