The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(hydroxy(octylamino)methylene)bis(phosphonic acid) ID: ALA5208362
PubChem CID: 168296593
Max Phase: Preclinical
Molecular Formula: C9H23NO7P2
Molecular Weight: 319.23
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCNC(O)(P(=O)(O)O)P(=O)(O)O
Standard InChI: InChI=1S/C9H23NO7P2/c1-2-3-4-5-6-7-8-10-9(11,18(12,13)14)19(15,16)17/h10-11H,2-8H2,1H3,(H2,12,13,14)(H2,15,16,17)
Standard InChI Key: PAHZLPYNPAACDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
19 18 0 0 0 0 0 0 0 0999 V2000
-0.7705 0.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0560 0.4671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0560 1.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 2.0065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7705 1.2921 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.4849 0.8780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7705 0.4655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1829 2.0065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7705 1.7046 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.1821 2.4203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 2.4203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4849 1.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7705 -0.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4849 -1.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4849 -2.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7705 -2.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0560 -2.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6584 -2.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3728 -2.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
3 5 1 0
5 6 1 0
5 7 1 0
5 8 2 0
3 9 1 0
9 10 1 0
9 11 2 0
9 12 1 0
1 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 319.23Molecular Weight (Monoisotopic): 319.0950AlogP: 0.90#Rotatable Bonds: 10Polar Surface Area: 147.32Molecular Species: ACIDHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: -0.53CX Basic pKa: 1.82CX LogP: 0.21CX LogD: -4.12Aromatic Rings: ┄Heavy Atoms: 19QED Weighted: 0.20Np Likeness Score: 0.19