1-(3-hydroxypropyl)-7,7-dimethyl-6,7-dihydro-1H,5H-pyrido[1,2,3-de]quinoxaline-2,3-dione

ID: ALA5208428

Cas Number: 1644387-48-3

PubChem CID: 90469308

Max Phase: Preclinical

Molecular Formula: C16H20N2O3

Molecular Weight: 288.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CCn2c(=O)c(=O)n(CCCO)c3cccc1c32

Standard InChI:  InChI=1S/C16H20N2O3/c1-16(2)7-9-18-13-11(16)5-3-6-12(13)17(8-4-10-19)14(20)15(18)21/h3,5-6,19H,4,7-10H2,1-2H3

Standard InChI Key:  AFXDIAGXPGAOKB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    0.3983    0.3570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1131   -0.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1131   -0.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4260   -1.2919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3160   -0.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0031   -1.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7177   -0.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7452   -0.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0305    0.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3160   -0.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0031   -2.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2885   -2.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4260   -2.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8276   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4154   -2.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8276   -1.2919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8276    0.3570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3983    1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3160    1.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3163    2.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0308    2.8310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  6 11  1  0
 11 12  1  0
 12 13  1  0
  4 13  1  0
 11 14  1  0
 11 15  1  0
  3 16  2  0
  2 17  2  0
  1 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Salmonella enterica (1497 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.35Molecular Weight (Monoisotopic): 288.1474AlogP: 1.23#Rotatable Bonds: 3
Polar Surface Area: 64.23Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.80CX LogD: 0.80
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.86Np Likeness Score: -0.08

References

1. Shingare RD, MacMillan JB, Reddy DS..  (2022)  Antibiotic natural product hunanamycin A: Lead identification towards anti-Salmonella agents.,  236  [PMID:35421661] [10.1016/j.ejmech.2022.114245]

Source