5-(4-(2-(3,5-diphenyl-4,5-dihydro-1H-pyrazol-1-yl)-2-oxoethoxy)benzylidene)thiazolidine-2,4-dione

ID: ALA5208471

PubChem CID: 168297065

Max Phase: Preclinical

Molecular Formula: C27H21N3O4S

Molecular Weight: 483.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)/C(=C\c2ccc(OCC(=O)N3N=C(c4ccccc4)CC3c3ccccc3)cc2)S1

Standard InChI:  InChI=1S/C27H21N3O4S/c31-25(17-34-21-13-11-18(12-14-21)15-24-26(32)28-27(33)35-24)30-23(20-9-5-2-6-10-20)16-22(29-30)19-7-3-1-4-8-19/h1-15,23H,16-17H2,(H,28,32,33)/b24-15+

Standard InChI Key:  VLCQEDLNVOGCBZ-BUVRLJJBSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -3.4059    0.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8947    1.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5636    2.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0523    2.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8723    2.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2034    2.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7145    1.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6562    0.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9861   -0.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9861   -1.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6932   -1.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6932   -2.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9716   -2.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2596   -2.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2596   -1.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3215    0.0503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5355   -0.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3592   -1.0059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9256    0.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1396    0.1052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4701    0.6608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2561    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8660    0.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6897    1.7719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2996    2.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0856    2.0771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3451    1.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8641    0.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1700    1.2941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4203    2.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2034    2.3445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7501    2.5659    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9037    2.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2939    1.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5810    0.8285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  2  2  0
  1  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 10  2  0
 16  9  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 30 29  1  0
 30 31  2  0
 32 30  1  0
 32 26  1  0
 24 33  2  0
 33 34  1  0
 34 21  2  0
 35 16  1  0
  1 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5208471

    ---

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC8 Tclin Histone deacetylase 8 (4516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1253AlogP: 4.77#Rotatable Bonds: 6
Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.20CX Basic pKa: 1.23CX LogP: 4.29CX LogD: 3.89
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.51Np Likeness Score: -1.39

References

1. Upadhyay N, Tilekar K, Safuan S, Kumar AP, Schweipert M, Meyer-Almes FJ, C S R..  (2021)  Multi-target weapons: diaryl-pyrazoline thiazolidinediones simultaneously targeting VEGFR-2 and HDAC cancer hallmarks.,  12  (9.0): [PMID:34671737] [10.1039/D1MD00125F]

Source