The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(2-(3,5-diphenyl-4,5-dihydro-1H-pyrazol-1-yl)-2-oxoethoxy)benzylidene)thiazolidine-2,4-dione ID: ALA5208471
PubChem CID: 168297065
Max Phase: Preclinical
Molecular Formula: C27H21N3O4S
Molecular Weight: 483.55
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C\c2ccc(OCC(=O)N3N=C(c4ccccc4)CC3c3ccccc3)cc2)S1
Standard InChI: InChI=1S/C27H21N3O4S/c31-25(17-34-21-13-11-18(12-14-21)15-24-26(32)28-27(33)35-24)30-23(20-9-5-2-6-10-20)16-22(29-30)19-7-3-1-4-8-19/h1-15,23H,16-17H2,(H,28,32,33)/b24-15+
Standard InChI Key: VLCQEDLNVOGCBZ-BUVRLJJBSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-3.4059 0.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8947 1.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5636 2.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0523 2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8723 2.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2034 2.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7145 1.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6562 0.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9861 -0.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9861 -1.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6932 -1.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6932 -2.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9716 -2.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2596 -2.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2596 -1.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3215 0.0503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5355 -0.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3592 -1.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9256 0.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1396 0.1052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4701 0.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2561 0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8660 0.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6897 1.7719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2996 2.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0856 2.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3451 1.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8641 0.6239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1700 1.2941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4203 2.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2034 2.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7501 2.5659 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.9037 2.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2939 1.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5810 0.8285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 2 2 0
1 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 10 2 0
16 9 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
27 29 1 0
30 29 1 0
30 31 2 0
32 30 1 0
32 26 1 0
24 33 2 0
33 34 1 0
34 21 2 0
35 16 1 0
1 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1253AlogP: 4.77#Rotatable Bonds: 6Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.20CX Basic pKa: 1.23CX LogP: 4.29CX LogD: 3.89Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.51Np Likeness Score: -1.39
References 1. Upadhyay N, Tilekar K, Safuan S, Kumar AP, Schweipert M, Meyer-Almes FJ, C S R.. (2021) Multi-target weapons: diaryl-pyrazoline thiazolidinediones simultaneously targeting VEGFR-2 and HDAC cancer hallmarks., 12 (9.0): [PMID:34671737 ] [10.1039/D1MD00125F ]