7-Benzyl-3-((trans)-4-methoxycyclohexyl)-5,6-diphenyl-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-imine

ID: ALA5208507

PubChem CID: 53377538

Max Phase: Preclinical

Molecular Formula: C32H32N4O

Molecular Weight: 488.64

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@H]1CC[C@H](n2cnc3c(c(-c4ccccc4)c(-c4ccccc4)n3Cc3ccccc3)c2=N)CC1

Standard InChI:  InChI=1S/C32H32N4O/c1-37-27-19-17-26(18-20-27)36-22-34-32-29(31(36)33)28(24-13-7-3-8-14-24)30(25-15-9-4-10-16-25)35(32)21-23-11-5-2-6-12-23/h2-16,22,26-27,33H,17-21H2,1H3/t26-,27-

Standard InChI Key:  ZQDMJMWQVLXWNY-MCZWQBSQSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   -0.0851    1.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0851    1.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6294    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4143    0.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6278    1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4281    1.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6369    2.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0554    3.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2582    3.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0446    2.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8993    0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7243    0.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1386   -0.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9631   -0.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3722    0.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9596    0.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1371    0.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4143   -0.4826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6278   -1.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0444   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2441   -1.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3355   -2.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1215   -3.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6756   -3.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2577   -2.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6294   -0.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0851   -0.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7999   -0.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7999    0.5976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5143    1.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5143    1.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2288    2.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9432    1.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9432    1.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2288    0.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6577    2.2476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3722    1.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  4 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 11 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
 26 18  1  0
 26  3  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 29  2  1  0
 30 29  1  1
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 30 35  1  0
 33 36  1  6
 36 37  1  0
M  END

Associated Targets(Human)

PC-3M (435 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.64Molecular Weight (Monoisotopic): 488.2576AlogP: 6.83#Rotatable Bonds: 6
Polar Surface Area: 55.83Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.37CX LogP: 6.50CX LogD: 5.50
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -0.43

References

1. Frankowski KJ, Patnaik S, Wang C, Southall N, Dutta D, De S, Li D, Dextras C, Lin YH, Bryant-Connah M, Davis D, Wang F, Wachsmuth LM, Shah P, Williams J, Kabir M, Zhu E, Baljinnyam B, Wang A, Xu X, Norton J, Ferrer M, Titus S, Simeonov A, Zheng W, Mathews Griner LA, Jadhav A, Aubé J, Henderson MJ, Rudloff U, Schoenen FJ, Huang S, Marugan JJ..  (2022)  Discovery and Optimization of Pyrrolopyrimidine Derivatives as Selective Disruptors of the Perinucleolar Compartment, a Marker of Tumor Progression toward Metastasis.,  65  (12.0): [PMID:35696646] [10.1021/acs.jmedchem.2c00204]

Source