7,7-Dimethyl-1-((2S,3S)-2,3,4-trihydroxybutyl)-6,7-dihydro-1H,5H-pyrido[1,2,3-de]quinoxaline-2,3-dione

ID: ALA5208543

PubChem CID: 168294389

Max Phase: Preclinical

Molecular Formula: C17H22N2O5

Molecular Weight: 334.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CCn2c(=O)c(=O)n(C[C@H](O)[C@@H](O)CO)c3cccc1c32

Standard InChI:  InChI=1S/C17H22N2O5/c1-17(2)6-7-18-14-10(17)4-3-5-11(14)19(16(24)15(18)23)8-12(21)13(22)9-20/h3-5,12-13,20-22H,6-9H2,1-2H3/t12-,13-/m0/s1

Standard InChI Key:  PXTNJEXZQVVJFE-STQMWFEESA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -1.7418   -0.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0271   -0.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3153   -0.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3153   -1.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0254   -1.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7418   -1.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3993   -0.0140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140   -0.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140   -1.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3993   -1.6645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3992   -2.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3154   -2.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0300   -2.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8286   -0.0140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8286   -1.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8286   -2.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2436   -3.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3993    0.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140    1.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140    2.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8286    0.8110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3993    2.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8286    2.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8286    3.2868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
  5 13  1  0
  8 14  2  0
  9 15  2  0
 13 16  1  0
 13 17  1  0
  7 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  1
 20 22  1  1
 20 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5208543

    ---

Associated Targets(non-human)

Salmonella enterica (1497 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 334.37Molecular Weight (Monoisotopic): 334.1529AlogP: -0.44#Rotatable Bonds: 4
Polar Surface Area: 104.69Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.22CX Basic pKa: CX LogP: -0.52CX LogD: -0.52
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.66Np Likeness Score: 0.39

References

1. Shingare RD, MacMillan JB, Reddy DS..  (2022)  Antibiotic natural product hunanamycin A: Lead identification towards anti-Salmonella agents.,  236  [PMID:35421661] [10.1016/j.ejmech.2022.114245]

Source