(S)-N-tert-butyl-4-(3-(3-carbamimidoylphenyl)-2-(2',4'-dimethoxybiphenyl-3-ylsulfonamido)propanoyl)piperazine-1-carboxamide

ID: ALA5208647

PubChem CID: 168296351

Max Phase: Preclinical

Molecular Formula: C33H42N6O6S

Molecular Weight: 650.80

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cccc(S(=O)(=O)N[C@@H](Cc3cccc(C(=N)N)c3)C(=O)N3CCN(C(=O)NC(C)(C)C)CC3)c2)c(OC)c1

Standard InChI:  InChI=1S/C33H42N6O6S/c1-33(2,3)36-32(41)39-16-14-38(15-17-39)31(40)28(19-22-8-6-10-24(18-22)30(34)35)37-46(42,43)26-11-7-9-23(20-26)27-13-12-25(44-4)21-29(27)45-5/h6-13,18,20-21,28,37H,14-17,19H2,1-5H3,(H3,34,35)(H,36,41)/t28-/m0/s1

Standard InChI Key:  KMTDLBRMZRXZBM-NDEPHWFRSA-N

Molfile:  

 
     RDKit          2D

 46 49  0  0  0  0  0  0  0  0999 V2000
   -1.4294    1.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0030    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0030    0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7130   -0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294    0.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441   -0.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1443   -1.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8572   -1.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -1.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5736   -0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8618    0.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7116   -0.2066    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4261    0.2058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2982   -0.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1234   -0.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407   -0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554    0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554    1.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700   -0.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554   -1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407    2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554    2.6812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554    3.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    3.9191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5702   -1.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2824   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2824   -2.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5721   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8554   -2.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5721   -3.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2867   -3.9191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8573   -3.9191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4297   -1.4481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4297   -2.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2867   -1.4461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2867   -2.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    3.9191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2845    3.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2844    2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9990    3.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9989    3.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
  4 13  1  0
 13 14  1  0
 13 15  2  0
 13 16  2  0
 14 17  1  0
 17 18  1  0
 17 19  1  6
 18 20  1  0
 18 21  2  0
 19 22  1  0
 23 20  1  0
 24 23  1  0
 27 26  1  0
 20 27  1  0
 30 22  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 22 34  1  0
 33 35  1  0
 35 36  2  0
 35 37  1  0
  8 38  1  0
 38 39  1  0
 10 40  1  0
 40 41  1  0
 25 24  1  0
 26 25  1  0
 25 28  1  0
 28 42  2  0
 28 29  1  0
 29 43  1  0
 43 44  1  0
 43 45  1  0
 43 46  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5208647

    ---

Associated Targets(Human)

ST14 Tchem Matriptase (677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

F2 Thrombin (1630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 650.80Molecular Weight (Monoisotopic): 650.2887AlogP: 3.20#Rotatable Bonds: 10
Polar Surface Area: 167.15Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.02CX Basic pKa: 11.47CX LogP: 2.04CX LogD: 0.13
Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.19Np Likeness Score: -0.98

References

1. Pilgram O, Keils A, Benary GE, Müller J, Merkl S, Ngaha S, Huber S, Chevillard F, Harbig A, Magdolen V, Heine A, Böttcher-Friebertshäuser E, Steinmetzer T..  (2022)  Improving the selectivity of 3-amidinophenylalanine-derived matriptase inhibitors.,  238  [PMID:35635944] [10.1016/j.ejmech.2022.114437]

Source