2-Oxo-3-((2-(pivaloylthio)ethoxy)((pyridin-2-ylmethyl)-amino)phosphoryl)piperidin-1-yl Acetate

ID: ALA5208721

PubChem CID: 155013136

Max Phase: Preclinical

Molecular Formula: C20H30N3O6PS

Molecular Weight: 471.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)ON1CCCC(P(=O)(NCc2ccccn2)OCCSC(=O)C(C)(C)C)C1=O

Standard InChI:  InChI=1S/C20H30N3O6PS/c1-15(24)29-23-11-7-9-17(18(23)25)30(27,22-14-16-8-5-6-10-21-16)28-12-13-31-19(26)20(2,3)4/h5-6,8,10,17H,7,9,11-14H2,1-4H3,(H,22,27)

Standard InChI Key:  JXVYIOFPUFXOTP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
    1.2978   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2978   -1.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0094   -1.2186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7183   -1.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7183   -2.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0111   -2.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5864   -1.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5864   -0.3970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1249    0.0137    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.2864    0.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1079    0.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5187    1.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3401    1.4378    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7508    2.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3401    2.8605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3938    2.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9831    1.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9831    2.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5349    0.7264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8363   -0.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5479    0.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5479    0.8352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2596   -0.3970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2596   -1.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5479   -1.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8363   -1.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9710    0.0137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6824   -0.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6824   -1.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3938    0.0137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  7  2  1  0
  8  7  1  0
  9  8  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
  9 20  2  0
 21  9  1  0
 21 22  1  0
 22 23  2  0
 24 22  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 21  1  0
 24 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5208721

    ---

Associated Targets(Human)

D-423MG (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.52Molecular Weight (Monoisotopic): 471.1593AlogP: 3.16#Rotatable Bonds: 9
Polar Surface Area: 114.90Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.13CX LogP: 1.64CX LogD: 1.64
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.51

References

1. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL..  (2022)  Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1-Deleted Cancers.,  65  (20.0): [PMID:36251833] [10.1021/acs.jmedchem.2c01039]

Source