The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Oxo-3-((2-(pivaloylthio)ethoxy)((pyridin-2-ylmethyl)-amino)phosphoryl)piperidin-1-yl Acetate ID: ALA5208721
PubChem CID: 155013136
Max Phase: Preclinical
Molecular Formula: C20H30N3O6PS
Molecular Weight: 471.52
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)ON1CCCC(P(=O)(NCc2ccccn2)OCCSC(=O)C(C)(C)C)C1=O
Standard InChI: InChI=1S/C20H30N3O6PS/c1-15(24)29-23-11-7-9-17(18(23)25)30(27,22-14-16-8-5-6-10-21-16)28-12-13-31-19(26)20(2,3)4/h5-6,8,10,17H,7,9,11-14H2,1-4H3,(H,22,27)
Standard InChI Key: JXVYIOFPUFXOTP-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
1.2978 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 -1.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0094 -1.2186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7183 -1.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7183 -2.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0111 -2.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5864 -1.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5864 -0.3970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1249 0.0137 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
0.2864 0.7264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1079 0.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5187 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3401 1.4378 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7508 2.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3401 2.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5724 2.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3938 2.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9831 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9831 2.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5349 0.7264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8363 -0.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5479 0.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5479 0.8352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2596 -0.3970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2596 -1.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5479 -1.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8363 -1.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9710 0.0137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6824 -0.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6824 -1.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3938 0.0137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
7 2 1 0
8 7 1 0
9 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
9 20 2 0
21 9 1 0
21 22 1 0
22 23 2 0
24 22 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 21 1 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.52Molecular Weight (Monoisotopic): 471.1593AlogP: 3.16#Rotatable Bonds: 9Polar Surface Area: 114.90Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.13CX LogP: 1.64CX LogD: 1.64Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -0.51
References 1. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL.. (2022) Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1 -Deleted Cancers., 65 (20.0): [PMID:36251833 ] [10.1021/acs.jmedchem.2c01039 ]