The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-nitro-2-(2-phenyl-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl)-6-(trifluoromethyl)-4H-benzo[e][1,3]thiazin-4-one ID: ALA5208732
PubChem CID: 71501206
Max Phase: Preclinical
Molecular Formula: C22H14F3N5O3S
Molecular Weight: 485.45
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1nc(N2CCc3nc(-c4ccccc4)ncc3C2)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12
Standard InChI: InChI=1S/C22H14F3N5O3S/c23-22(24,25)14-8-15-18(17(9-14)30(32)33)34-21(28-20(15)31)29-7-6-16-13(11-29)10-26-19(27-16)12-4-2-1-3-5-12/h1-5,8-10H,6-7,11H2
Standard InChI Key: HCGNJFIXTGQBFG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
1.4364 0.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4364 0.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7210 -0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0004 0.0031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0004 0.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7230 1.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7139 -0.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4336 0.0065 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1464 -0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1464 -1.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 -1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7139 -1.2392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 -2.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8635 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5796 -1.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5796 -0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8635 0.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8635 0.8325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5780 1.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1491 1.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2934 -1.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2922 -2.4798 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0081 -1.2420 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.0081 -2.0672 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1490 1.2436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8637 0.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8656 0.0104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1541 -0.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5784 1.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5787 2.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2916 2.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0065 2.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0081 1.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2962 0.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
4 5 1 0
1 6 1 0
6 5 1 0
4 7 1 0
8 7 1 0
8 9 1 0
10 9 2 0
11 10 1 0
7 12 2 0
12 11 1 0
11 13 2 0
14 10 1 0
15 14 2 0
16 15 1 0
17 16 2 0
17 9 1 0
18 17 1 0
18 19 2 0
18 20 1 0
21 15 1 0
21 22 1 0
21 23 1 0
21 24 1 0
1 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
2 28 1 0
26 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
M CHG 2 18 1 20 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.45Molecular Weight (Monoisotopic): 485.0769AlogP: 4.60#Rotatable Bonds: 3Polar Surface Area: 102.12Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.10CX LogP: 5.23CX LogD: 5.23Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.69
References 1. Schieferdecker S, Bernal FA, Wojtas KP, Keiff F, Li Y, Dahse HM, Kloss F.. (2022) Development of Predictive Classification Models for Whole Cell Antimycobacterial Activity of Benzothiazinones., 65 (9.0): [PMID:35502994 ] [10.1021/acs.jmedchem.2c00098 ]