8-benzoyl-2-(3-chlorobenzyl)-2,8-diazaspiro[4.5]decan-1-one

ID: ALA5208733

PubChem CID: 168294710

Max Phase: Preclinical

Molecular Formula: C22H23ClN2O2

Molecular Weight: 382.89

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccccc1)N1CCC2(CC1)CCN(Cc1cccc(Cl)c1)C2=O

Standard InChI:  InChI=1S/C22H23ClN2O2/c23-19-8-4-5-17(15-19)16-25-14-11-22(21(25)27)9-12-24(13-10-22)20(26)18-6-2-1-3-7-18/h1-8,15H,9-14,16H2

Standard InChI Key:  KYLCTBFFZMCLNT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -2.9242    0.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7492    0.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1607    1.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7555    1.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9304    1.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5106    1.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5129   -0.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9222   -1.0829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6921   -0.3716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2757   -1.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4476   -1.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0344   -0.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4490    0.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2380    0.0459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2380   -0.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558   -1.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8995    0.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6509    0.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7388   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4971   -0.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1607   -0.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0661    0.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3146    0.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5918   -1.7589    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.1914    1.0772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4476    0.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2757    0.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  1  6  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 17 14  1  0
 18 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 18 23  1  0
 24 20  1  0
 13 25  2  0
 12 26  1  0
  9 27  1  0
 27 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5208733

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.89Molecular Weight (Monoisotopic): 382.1448AlogP: 3.99#Rotatable Bonds: 3
Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.40CX LogD: 3.40
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.80Np Likeness Score: -1.38

References

1. Niu A, Lin L, Zhang D, Jiang K, Weng D, Zhou W, Wang J..  (2022)  Discovery of novel 2,8-diazaspiro[4.5]decan-1-one derivatives as potent RIPK1 kinase inhibitors.,  59  [PMID:35228069] [10.1016/j.bmc.2022.116686]

Source