The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((3-(3,5-dimethoxybenzoyl)-1H-pyrrolo[2,3-b]pyridin-6-yl)amino)-5-(4-methylpiperazin-1-yl)phenyl)acrylamide ID: ALA5208777
PubChem CID: 146271387
Max Phase: Preclinical
Molecular Formula: C30H32N6O4
Molecular Weight: 540.62
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(N2CCN(C)CC2)ccc1Nc1ccc2c(C(=O)c3cc(OC)cc(OC)c3)c[nH]c2n1
Standard InChI: InChI=1S/C30H32N6O4/c1-5-28(37)33-26-16-20(36-12-10-35(2)11-13-36)6-8-25(26)32-27-9-7-23-24(18-31-30(23)34-27)29(38)19-14-21(39-3)17-22(15-19)40-4/h5-9,14-18H,1,10-13H2,2-4H3,(H,33,37)(H2,31,32,34)
Standard InChI Key: VBNPVHZLJCLFKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-0.8656 0.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5803 0.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5803 1.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1511 0.6320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8656 -0.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5803 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5803 -1.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2948 -2.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0093 -1.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0093 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2948 -0.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7240 -0.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7240 0.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4385 0.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1531 0.2198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1531 -0.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4385 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8677 0.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8656 -2.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1511 -1.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1511 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5634 -0.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2780 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2780 -1.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5634 -2.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0475 -2.0886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5421 -1.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0475 -0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2948 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0919 0.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3117 1.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1087 1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6859 0.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4935 -0.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6965 -0.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0707 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8677 -0.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3286 2.0612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1256 2.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7177 0.6046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
1 4 2 0
1 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 17 1 0
15 18 1 0
7 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
20 25 1 0
24 25 2 0
24 26 1 0
26 27 1 0
28 27 2 0
23 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
34 36 1 0
36 37 1 0
32 38 1 0
38 39 1 0
29 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.62Molecular Weight (Monoisotopic): 540.2485AlogP: 4.43#Rotatable Bonds: 9Polar Surface Area: 111.82Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.52CX Basic pKa: 7.87CX LogP: 4.35CX LogD: 3.75Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -0.94
References 1. Zhong Z, Shi L, Fu T, Huang J, Pan Z.. (2022) Discovery of Novel 7-Azaindole Derivatives as Selective Covalent Fibroblast Growth Factor Receptor 4 Inhibitors for the Treatment of Hepatocellular Carcinoma., 65 (10.0): [PMID:35549181 ] [10.1021/acs.jmedchem.2c00255 ]