N-(3-cyano-1-(4-bromobenzyl)-1H-indol-5-yl]-6-oxo-1,6-dihydropyrimidine-4-carboxamide

ID: ALA5208786

PubChem CID: 156780193

Max Phase: Preclinical

Molecular Formula: C21H14BrN5O2

Molecular Weight: 448.28

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1cn(Cc2ccc(Br)cc2)c2ccc(NC(=O)c3cc(=O)[nH]cn3)cc12

Standard InChI:  InChI=1S/C21H14BrN5O2/c22-15-3-1-13(2-4-15)10-27-11-14(9-23)17-7-16(5-6-19(17)27)26-21(29)18-8-20(28)25-12-24-18/h1-8,11-12H,10H2,(H,26,29)(H,24,25,28)

Standard InChI Key:  FZGSOLJGDAITGB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -1.0178    0.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3033    0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4085    0.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4085   -0.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3014   -0.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0178   -0.5209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1915   -0.7631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6835   -0.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2127    0.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4263    1.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6398    2.1522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4050   -1.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2021   -1.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7858   -1.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5803   -1.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7939   -2.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -2.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4166   -2.5742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5910   -2.4149    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -1.7325    0.7201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4472    0.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1617    0.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8764    0.3075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5910    0.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5910    1.5453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8764    1.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1617    1.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8764    2.7831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4472   -0.5176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  9  8  2  0
  3  9  1  0
 10  9  1  0
 10 11  3  0
  7 12  1  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 22 27  2  0
 26 28  2  0
 21 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5208786

    ---

Associated Targets(Human)

XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.28Molecular Weight (Monoisotopic): 447.0331AlogP: 3.66#Rotatable Bonds: 4
Polar Surface Area: 103.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.36CX Basic pKa: CX LogP: 3.18CX LogD: 3.14
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.76

References

1. Zhang B, Duan Y, Yang Y, Mao Q, Lin F, Gao J, Dai X, Zhang P, Li Q, Li J, Dai R, Wang S..  (2022)  Design, synthesis, and biological evaluation of N-(3-cyano-1H-indol-5/6-yl)-6-oxo-1,6-dihydropyrimidine-4-carboxamides and 5-(6-oxo-1,6-dihydropyrimidin-2-yl)-1H-indole-3-carbonitriles as novel xanthine oxidase inhibitors.,  227  [PMID:34688012] [10.1016/j.ejmech.2021.113928]

Source