The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-imidazol-1-ylpropyl)-4-[1-(thiophene-2-carbonyl)indol-3-yl]butanamide ID: ALA5208860
PubChem CID: 168297503
Max Phase: Preclinical
Molecular Formula: C23H24N4O2S
Molecular Weight: 420.54
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCc1cn(C(=O)c2cccs2)c2ccccc12)NCCCn1ccnc1
Standard InChI: InChI=1S/C23H24N4O2S/c28-22(25-11-5-13-26-14-12-24-17-26)10-3-6-18-16-27(20-8-2-1-7-19(18)20)23(29)21-9-4-15-30-21/h1-2,4,7-9,12,14-17H,3,5-6,10-11,13H2,(H,25,28)
Standard InChI Key: YRGSCPWKARMEOF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-2.1672 0.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4528 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2535 -0.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0604 -0.4836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4728 0.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9208 0.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2771 0.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5323 1.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9844 1.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1770 1.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7384 0.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0242 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6900 0.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4043 0.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6900 -0.3163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1186 0.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8329 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5471 0.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2615 0.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3476 1.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1540 1.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5662 1.1982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0145 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4727 -1.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2976 -1.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0604 -1.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7821 -1.8647 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.5662 -1.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5662 -0.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7821 -0.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
6 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 19 1 0
4 24 1 0
24 25 1 0
24 26 2 0
27 25 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 25 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.54Molecular Weight (Monoisotopic): 420.1620AlogP: 4.12#Rotatable Bonds: 9Polar Surface Area: 68.92Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.79CX LogP: 3.07CX LogD: 3.00Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -1.64
References 1. Kraupner N, Dinh CP, Wen X, Landry V, Herledan A, Leroux F, Bosc D, Charton J, Maillard C, Warenghem S, Duplan I, Piveteau C, Hennuyer N, Staels B, Deprez B, Deprez-Poulain R.. (2022) Identification of indole-based activators of insulin degrading enzyme., 228 [PMID:34815130 ] [10.1016/j.ejmech.2021.113982 ]