Cryptosphaerolide

ID: ALA5208863

PubChem CID: 168297505

Max Phase: Preclinical

Molecular Formula: C25H40O8

Molecular Weight: 468.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(C)CC(C)CC(O)(CO)C(=O)O[C@@H]1CC[C@H](C)[C@@]2(C)C[C@H]3C(=O)CO[C@@]3(O)[C@H]3O[C@@]312

Standard InChI:  InChI=1S/C25H40O8/c1-6-14(2)9-15(3)10-23(29,13-26)21(28)32-19-8-7-16(4)22(5)11-17-18(27)12-31-25(17,30)20-24(19,22)33-20/h14-17,19-20,26,29-30H,6-13H2,1-5H3/t14?,15?,16-,17-,19+,20-,22+,23?,24+,25+/m0/s1

Standard InChI Key:  VTCFSWHQPFTFKQ-JBMDUNQHSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.8663    2.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1519    3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4374    2.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4374    2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1519    1.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8663    2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2771    3.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9915    2.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9915    2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2771    1.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6509    3.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6509    1.8083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1358    2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8645    3.9404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8663    3.7136    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9526    1.2425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4374    3.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2771    4.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2771    0.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7064    0.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7064   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7064   -1.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4211   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1946   -0.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3888   -0.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5790   -1.1271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4211   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1358   -3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7064   -3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1358   -4.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4383    1.2398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1519    0.8255    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  1 11  1  0
  6 12  1  0
 12 13  1  0
 13 11  1  0
 11 14  2  0
  1 15  1  1
  6 16  1  1
  3 17  1  1
  7 18  1  1
 10 19  1  1
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 21 27  1  0
 27 28  1  0
 21 29  1  0
 25 30  1  0
 30 31  1  0
 30 32  1  0
 31 33  1  0
  4 34  1  6
  5 34  1  0
  5 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5208863

    ---

Associated Targets(Human)

MCL1 Tchem MCL1-BAK1 complex (39 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.59Molecular Weight (Monoisotopic): 468.2723AlogP: 1.97#Rotatable Bonds: 8
Polar Surface Area: 125.82Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.61CX Basic pKa: CX LogP: 3.35CX LogD: 3.35
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: 2.76

References

1. Negi A, Murphy PV..  (2021)  Development of Mcl-1 inhibitors for cancer therapy.,  210  [PMID:33333396] [10.1016/j.ejmech.2020.113038]

Source