The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cryptosphaerolide ID: ALA5208863
PubChem CID: 168297505
Max Phase: Preclinical
Molecular Formula: C25H40O8
Molecular Weight: 468.59
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)CC(C)CC(O)(CO)C(=O)O[C@@H]1CC[C@H](C)[C@@]2(C)C[C@H]3C(=O)CO[C@@]3(O)[C@H]3O[C@@]312
Standard InChI: InChI=1S/C25H40O8/c1-6-14(2)9-15(3)10-23(29,13-26)21(28)32-19-8-7-16(4)22(5)11-17-18(27)12-31-25(17,30)20-24(19,22)33-20/h14-17,19-20,26,29-30H,6-13H2,1-5H3/t14?,15?,16-,17-,19+,20-,22+,23?,24+,25+/m0/s1
Standard InChI Key: VTCFSWHQPFTFKQ-JBMDUNQHSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.8663 2.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1519 3.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4374 2.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4374 2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1519 1.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8663 2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2771 3.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9915 2.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9915 2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2771 1.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6509 3.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6509 1.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1358 2.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8645 3.9404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8663 3.7136 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.9526 1.2425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4374 3.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2771 4.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2771 0.8255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7064 0.8255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7064 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7064 -1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4211 -2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9917 -2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1946 -0.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3888 -0.7823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5790 -1.1271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4211 -2.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1358 -3.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7064 -3.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1358 -4.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4383 1.2398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1519 0.8255 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
4 10 1 0
1 11 1 0
6 12 1 0
12 13 1 0
13 11 1 0
11 14 2 0
1 15 1 1
6 16 1 1
3 17 1 1
7 18 1 1
10 19 1 1
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
21 27 1 0
27 28 1 0
21 29 1 0
25 30 1 0
30 31 1 0
30 32 1 0
31 33 1 0
4 34 1 6
5 34 1 0
5 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.59Molecular Weight (Monoisotopic): 468.2723AlogP: 1.97#Rotatable Bonds: 8Polar Surface Area: 125.82Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.61CX Basic pKa: ┄CX LogP: 3.35CX LogD: 3.35Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: 2.76