The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((4-((2,2-difluoro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)amino)-5-methylpyrimidin-2-yl)amino)benzenesulfonamide ID: ALA5208935
PubChem CID: 67046929
Max Phase: Preclinical
Molecular Formula: C19H16F2N6O4S
Molecular Weight: 462.44
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(Nc2cccc(S(N)(=O)=O)c2)nc1Nc1ccc2c(c1)NC(=O)C(F)(F)O2
Standard InChI: InChI=1S/C19H16F2N6O4S/c1-10-9-23-18(25-11-3-2-4-13(7-11)32(22,29)30)27-16(10)24-12-5-6-15-14(8-12)26-17(28)19(20,21)31-15/h2-9H,1H3,(H,26,28)(H2,22,29,30)(H2,23,24,25,27)
Standard InChI Key: HVLJIZBQOBSBKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-5.4146 0.6154 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5896 0.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0028 1.3313 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5896 -0.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3041 -0.6222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8749 -0.6224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1602 -0.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4424 -0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7307 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0161 -0.6197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3015 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4158 -0.6214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1274 -0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8420 -0.6176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5564 -0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2740 -0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9856 -0.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7002 -0.6154 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1118 -1.3313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2868 -1.3313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4146 -0.2030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9856 0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2693 1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5564 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1274 0.6158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4112 1.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3015 0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0159 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7307 0.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4474 1.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1602 0.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8749 1.0281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
2 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
18 20 2 0
18 21 1 0
17 22 1 0
22 23 2 0
23 24 1 0
24 15 2 0
13 25 1 0
25 26 2 0
26 27 1 0
27 11 2 0
27 28 1 0
9 29 1 0
29 30 2 0
31 30 1 0
7 31 2 0
31 32 1 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.44Molecular Weight (Monoisotopic): 462.0922AlogP: 2.84#Rotatable Bonds: 5Polar Surface Area: 148.33Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.76CX Basic pKa: 4.25CX LogP: 3.26CX LogD: 3.25Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: -1.34
References 1. Chen Y, Li H, Yen R, Heckrodt TJ, McMurtrie D, Singh R, Taylor V, Masuda ES, Park G, Payan DG.. (2022) Optimization of Pyrimidine Compounds as Potent JAK1 Inhibitors and the Discovery of R507 as a Clinical Candidate., 13 (11.0): [PMID:36385926 ] [10.1021/acsmedchemlett.2c00411 ]