N-[4-[3-(m-tolyl)-1,2,4-oxadiazol-5-yl]phenyl]-5-oxo-1-(3-pyridylmethyl)pyrrolidine-3-carboxamide

ID: ALA5209142

PubChem CID: 165117354

Max Phase: Preclinical

Molecular Formula: C26H23N5O3

Molecular Weight: 453.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-c2noc(-c3ccc(NC(=O)C4CC(=O)N(Cc5cccnc5)C4)cc3)n2)c1

Standard InChI:  InChI=1S/C26H23N5O3/c1-17-4-2-6-20(12-17)24-29-26(34-30-24)19-7-9-22(10-8-19)28-25(33)21-13-23(32)31(16-21)15-18-5-3-11-27-14-18/h2-12,14,21H,13,15-16H2,1H3,(H,28,33)

Standard InChI Key:  MKSGJDMKVXLTSQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.0009    0.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7155    0.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274    0.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274   -0.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7173   -1.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0009   -0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420   -1.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8955   -0.8446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4474   -1.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0351   -2.1719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2282   -2.0004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131    0.4695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273    0.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1415    0.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -0.7674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8945    0.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4461    0.7468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0340    1.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2277    1.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4463    2.1748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2708    0.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6832    0.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2710   -0.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6827   -1.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5077   -1.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9193   -0.6834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5114    0.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2721   -1.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6847   -0.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5069   -0.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9193   -1.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5104   -2.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6862   -2.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9192   -0.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  4  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  1 12  1  0
 12 13  1  0
 14 13  1  0
 13 15  2  0
 16 14  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
 18 20  2  0
 17 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
  9 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5209142

    ---

Associated Targets(Human)

RXFP3 Tchem Relaxin-3 receptor 1 (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.1801AlogP: 4.09#Rotatable Bonds: 6
Polar Surface Area: 101.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.29CX Basic pKa: 4.81CX LogP: 3.79CX LogD: 3.79
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -2.08

References

1. Gay EA, Guan D, Van Voorhies K, Vasukuttan V, Mathews KM, Besheer J, Jin C..  (2022)  Discovery and Characterization of the First Nonpeptide Antagonists for the Relaxin-3/RXFP3 System.,  65  (11.0): [PMID:35594150] [10.1021/acs.jmedchem.2c00508]

Source