(2E,4E)-2-(4-Hydroxyphenyl)-5-phenyl-1-(4-(pyrimidin-2-yl)piperazin-1-yl)penta-2,4-dien-1-one

ID: ALA5209150

PubChem CID: 168296658

Max Phase: Preclinical

Molecular Formula: C25H24N4O2

Molecular Weight: 412.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C(=C/C=C/c1ccccc1)c1ccc(O)cc1)N1CCN(c2ncccn2)CC1

Standard InChI:  InChI=1S/C25H24N4O2/c30-22-12-10-21(11-13-22)23(9-4-8-20-6-2-1-3-7-20)24(31)28-16-18-29(19-17-28)25-26-14-5-15-27-25/h1-15,30H,16-19H2/b8-4+,23-9+

Standard InChI Key:  YUIPOWNGMINMSJ-KOTYPSLTSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -2.4851   -1.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1996   -1.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4851   -2.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1971   -2.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9092   -2.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9092   -1.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   -1.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7780   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708    1.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3612    1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3612    2.2610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3507    1.0320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0660    1.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7818    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7818    0.2113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0733   -0.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3507    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4938   -0.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4938   -1.0218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2058   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9178   -1.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9178   -0.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2058    0.2198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7828    1.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7828    2.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4948    2.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2068    2.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2068    1.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4948    1.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9178    2.6716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  4  3  2  0
  5  4  1  0
  2  6  1  0
  6  5  2  0
  1  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 19 16  1  0
 20 19  2  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
 25 10  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5209150

    ---

Associated Targets(non-human)

HT-22 (3261 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.1899AlogP: 3.63#Rotatable Bonds: 5
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.07CX Basic pKa: 3.20CX LogP: 4.16CX LogD: 4.15
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.70

References

1. Fang Y, Tan Q, Zhou H, Gu Q, Xu J..  (2022)  Discovery of novel diphenylbutene derivative ferroptosis inhibitors as neuroprotective agents.,  231  [PMID:35123296] [10.1016/j.ejmech.2022.114151]

Source