The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-Bromophenyl)-3-[(5Z)-4-oxo-5-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2-thioxothiazolidin-3-yl]pyrrolidine-2,5-dione ID: ALA5209189
PubChem CID: 168297093
Max Phase: Preclinical
Molecular Formula: C21H12BrN3O4S2
Molecular Weight: 514.38
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Nc2ccccc2/C1=C1/SC(=S)N(C2CC(=O)N(c3ccc(Br)cc3)C2=O)C1=O
Standard InChI: InChI=1S/C21H12BrN3O4S2/c22-10-5-7-11(8-6-10)24-15(26)9-14(19(24)28)25-20(29)17(31-21(25)30)16-12-3-1-2-4-13(12)23-18(16)27/h1-8,14H,9H2,(H,23,27)/b17-16-
Standard InChI Key: NYQWCSMDEFCKQE-MSUUIHNZSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
0.0825 -1.7874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0825 -0.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8799 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3475 -1.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8799 -2.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1274 -2.8050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1274 0.0825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 0.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 1.1550 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.1274 1.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6324 0.7425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1925 0.7425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8799 2.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3475 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8799 3.5475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0825 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6324 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3475 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3475 2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6324 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0825 2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1725 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5850 -0.1374 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5775 -0.4674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5775 -2.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4950 -3.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1550 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9250 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0075 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3200 -1.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5850 -3.7125 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
5 6 2 0
3 7 1 0
8 7 1 0
9 8 1 0
9 10 1 0
7 11 1 0
11 10 1 0
11 12 2 0
10 13 2 0
14 13 1 0
15 14 1 0
15 16 1 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
13 21 1 0
21 20 1 0
21 16 2 0
14 22 2 0
8 23 2 0
2 24 2 0
1 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.38Molecular Weight (Monoisotopic): 512.9453AlogP: 3.30#Rotatable Bonds: 2Polar Surface Area: 86.79Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.41CX Basic pKa: ┄CX LogP: 3.38CX LogD: 3.08Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -1.03
References 1. Finiuk N, Kryshchyshyn-Dylevych A, Holota S, Klyuchivska O, Kozytskiy A, Karpenko O, Manko N, Ivasechko I, Stoika R, Lesyk R.. (2022) Novel hybrid pyrrolidinedione-thiazolidinones as potential anticancer agents: Synthesis and biological evaluation., 238 [PMID:35533562 ] [10.1016/j.ejmech.2022.114422 ]