The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-(3-(difluoromethyl)-5-methoxyphenylamino)-5methylpyrimidin-4-ylamino)benzo[d]oxazol-2(3H)-one ID: ALA5209379
PubChem CID: 66659498
Max Phase: Preclinical
Molecular Formula: C20H17F2N5O3
Molecular Weight: 413.38
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2ncc(C)c(Nc3ccc4oc(=O)[nH]c4c3)n2)cc(C(F)F)c1
Standard InChI: InChI=1S/C20H17F2N5O3/c1-10-9-23-19(25-13-5-11(17(21)22)6-14(7-13)29-2)27-18(10)24-12-3-4-16-15(8-12)26-20(28)30-16/h3-9,17H,1-2H3,(H,26,28)(H2,23,24,25,27)
Standard InChI Key: HXRHQLSAMGVMPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-5.3348 -0.2177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5098 -0.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0180 0.4496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2351 0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2351 -0.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0392 -0.8713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5233 -1.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8088 -0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0945 -1.0331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3799 -0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3371 -1.0349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0486 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7629 -1.0310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4771 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1947 -1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9061 -0.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9061 0.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1901 0.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4771 0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1901 1.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4756 1.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6204 -1.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3348 -0.6166 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6204 -1.8538 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0486 0.2018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3325 0.6145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3799 0.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0943 0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8088 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5250 0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
4 5 2 0
5 6 1 0
6 2 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 2 0
18 20 1 0
20 21 1 0
16 22 1 0
22 23 1 0
22 24 1 0
12 25 1 0
25 26 2 0
26 27 1 0
27 10 2 0
27 28 1 0
8 29 1 0
29 30 2 0
30 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.38Molecular Weight (Monoisotopic): 413.1299AlogP: 4.65#Rotatable Bonds: 6Polar Surface Area: 105.07Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.45CX Basic pKa: 4.34CX LogP: 4.31CX LogD: 4.30Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.29
References 1. Chen Y, Li H, Yen R, Heckrodt TJ, McMurtrie D, Singh R, Taylor V, Masuda ES, Park G, Payan DG.. (2022) Optimization of Pyrimidine Compounds as Potent JAK1 Inhibitors and the Discovery of R507 as a Clinical Candidate., 13 (11.0): [PMID:36385926 ] [10.1021/acsmedchemlett.2c00411 ]