N-(5-fluoro-6-(4-fluoro-3-(2-(3-(trifluoromethyl)phenyl)acetamido)phenoxy)benzo[d]thiazol-2-yl)cyclopropanecarboxamide

ID: ALA5209456

PubChem CID: 168295272

Max Phase: Preclinical

Molecular Formula: C26H18F5N3O3S

Molecular Weight: 547.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1cccc(C(F)(F)F)c1)Nc1cc(Oc2cc3sc(NC(=O)C4CC4)nc3cc2F)ccc1F

Standard InChI:  InChI=1S/C26H18F5N3O3S/c27-17-7-6-16(10-19(17)32-23(35)9-13-2-1-3-15(8-13)26(29,30)31)37-21-12-22-20(11-18(21)28)33-25(38-22)34-24(36)14-4-5-14/h1-3,6-8,10-12,14H,4-5,9H2,(H,32,35)(H,33,34,36)

Standard InChI Key:  BQLWMSXWRKLECS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    1.5478    0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2624    0.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9742    0.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9742   -0.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2642   -0.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5478   -0.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7590   -0.5547    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7590    0.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2440    0.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0692    0.1128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4818    0.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3070    0.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0692    1.5420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8331   -0.7160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1185   -0.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5962   -0.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083   -0.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3083    0.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5980    0.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1185    0.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0230   -0.7164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7375   -0.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4522   -0.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7375    0.5213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1669   -0.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8817   -0.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5937   -0.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5937    0.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8834    0.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1669    0.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3084   -0.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3084   -1.5420    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0230   -0.3042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0230   -1.1293    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0230    0.9341    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0230    0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0221    1.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8331    0.9376    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  6 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 27 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 18 35  1  0
 36 12  1  0
 36 37  1  0
 12 37  1  0
  1 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5209456

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RIPK3 Tchem Receptor-interacting serine/threonine-protein kinase 3 (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.51Molecular Weight (Monoisotopic): 547.0989AlogP: 6.92#Rotatable Bonds: 7
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.91CX Basic pKa: CX LogP: 6.55CX LogD: 6.44
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -2.20

References

1. Shi K, Zhang J, Zhou E, Wang J, Wang Y..  (2022)  Small-Molecule Receptor-Interacting Protein 1 (RIP1) Inhibitors as Therapeutic Agents for Multifaceted Diseases: Current Medicinal Chemistry Insights and Emerging Opportunities.,  65  (22.0): [PMID:36346971] [10.1021/acs.jmedchem.2c01518]

Source