The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5209486
PubChem CID: 168296156
Max Phase: Preclinical
Molecular Formula: C24H21ClFN5O3
Molecular Weight: 481.92
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1cccc(Cl)c1F)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1
Standard InChI: InChI=1S/C24H21ClFN5O3/c25-19-3-1-2-16(22(19)26)13-28-24(32)17-5-4-15-12-20(17)34-11-10-33-9-7-27-21-6-8-31-23(30-21)18(15)14-29-31/h1-6,8,12,14H,7,9-11,13H2,(H,27,30)(H,28,32)
Standard InChI Key: GHNOIYYQSAILMY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-2.5335 2.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8190 3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1046 2.8064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1046 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8190 1.5689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5335 1.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3200 1.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3200 3.0613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1648 2.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2477 1.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2477 0.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9619 0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9619 -0.4927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2477 -0.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5335 -0.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8192 -0.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3200 0.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3940 0.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3933 -0.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3210 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0325 -0.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0373 0.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3210 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3931 -1.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0353 -1.9826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1073 -1.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8216 -1.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5360 -1.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2477 -1.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2477 -2.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5377 -3.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8216 -2.8109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9619 -1.5699 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5360 -0.7457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 2 0
3 8 1 0
8 9 2 0
9 7 1 0
6 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
7 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
21 16 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
29 33 1 0
28 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.92Molecular Weight (Monoisotopic): 481.1317AlogP: 3.94#Rotatable Bonds: 3Polar Surface Area: 89.78Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.68CX Basic pKa: 1.17CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.51
References 1. Kurz CG, Preuss F, Tjaden A, Cusack M, Amrhein JA, Chatterjee D, Mathea S, Berger LM, Berger BT, Krämer A, Weller M, Weiss T, Müller S, Knapp S, Hanke T.. (2022) Illuminating the Dark: Highly Selective Inhibition of Serine/Threonine Kinase 17A with Pyrazolo[1,5-a ]pyrimidine-Based Macrocycles., 65 (11.0): [PMID:35608370 ] [10.1021/acs.jmedchem.2c00173 ]