ID: ALA5209486

PubChem CID: 168296156

Max Phase: Preclinical

Molecular Formula: C24H21ClFN5O3

Molecular Weight: 481.92

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1cccc(Cl)c1F)c1ccc2cc1OCCOCCNc1ccn3ncc-2c3n1

Standard InChI:  InChI=1S/C24H21ClFN5O3/c25-19-3-1-2-16(22(19)26)13-28-24(32)17-5-4-15-12-20(17)34-11-10-33-9-7-27-21-6-8-31-23(30-21)18(15)14-29-31/h1-6,8,12,14H,7,9-11,13H2,(H,27,30)(H,28,32)

Standard InChI Key:  GHNOIYYQSAILMY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -2.5335    2.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8190    3.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1046    2.8064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1046    1.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8190    1.5689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5335    1.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3200    1.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3200    3.0613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1648    2.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2477    1.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2477    0.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9619    0.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9619   -0.4927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2477   -0.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5335   -0.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8192   -0.9051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3200    0.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3940    0.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3933   -0.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3210   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0325   -0.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0373    0.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3210   -1.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3931   -1.9826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0353   -1.9826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1073   -1.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8216   -1.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5360   -1.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2477   -1.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2477   -2.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5377   -3.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8216   -2.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9619   -1.5699    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5360   -0.7457    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  2  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  7 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 21 16  1  0
 22 21  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 29 33  1  0
 28 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5209486

    ---

Associated Targets(Human)

STK17B Tchem Serine/threonine-protein kinase 17B (773 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.92Molecular Weight (Monoisotopic): 481.1317AlogP: 3.94#Rotatable Bonds: 3
Polar Surface Area: 89.78Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.68CX Basic pKa: 1.17CX LogP: 3.54CX LogD: 3.54
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.51

References

1. Kurz CG, Preuss F, Tjaden A, Cusack M, Amrhein JA, Chatterjee D, Mathea S, Berger LM, Berger BT, Krämer A, Weller M, Weiss T, Müller S, Knapp S, Hanke T..  (2022)  Illuminating the Dark: Highly Selective Inhibition of Serine/Threonine Kinase 17A with Pyrazolo[1,5-a]pyrimidine-Based Macrocycles.,  65  (11.0): [PMID:35608370] [10.1021/acs.jmedchem.2c00173]

Source