The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-chloro-6-methylphenyl)-7-((2-methoxy-4-(1-methylpiperidin-4-yl)phenyl)amino)-1-(5-methoxypyridin-2-yl)-3,4-dihydropyrimido[4,5-d]pyrimidin-2(1H)-one ID: ALA5209511
PubChem CID: 121596782
Product Number: Y422363, Order Now?
Max Phase: Preclinical
Molecular Formula: C32H34ClN7O3
Molecular Weight: 600.12
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2C(=O)N(c3c(C)cccc3Cl)Cc3cnc(Nc4ccc(C5CCN(C)CC5)cc4OC)nc32)nc1
Standard InChI: InChI=1S/C32H34ClN7O3/c1-20-6-5-7-25(33)29(20)39-19-23-17-35-31(37-30(23)40(32(39)41)28-11-9-24(42-3)18-34-28)36-26-10-8-22(16-27(26)43-4)21-12-14-38(2)15-13-21/h5-11,16-18,21H,12-15,19H2,1-4H3,(H,35,36,37)
Standard InChI Key: VQINULODWGEVBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
8.6832 -5.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9684 -6.1374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9677 -6.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2528 -7.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2518 -8.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9665 -8.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6837 -8.1947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6812 -7.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9661 -9.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -9.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2485 -10.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9614 -11.0832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6775 -10.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6807 -9.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9587 -11.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3942 -6.1418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3904 -4.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6790 -4.9052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1096 -4.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1066 -5.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8174 -6.1454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5357 -5.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5388 -4.9097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8234 -4.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2552 -4.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9639 -4.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6798 -4.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6841 -3.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9665 -3.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2535 -3.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2482 -6.1530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8126 -6.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0944 -7.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0899 -8.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8028 -8.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5219 -8.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5228 -7.3799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7991 -9.4394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5121 -9.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5387 -3.2690 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.9571 -5.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5436 -6.9596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8284 -7.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
6 9 1 0
12 15 1 0
1 16 2 0
16 20 1 0
19 17 1 0
17 18 2 0
18 1 1 0
19 20 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
22 31 2 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
21 32 1 0
38 39 1 0
35 38 1 0
30 40 1 0
26 41 1 0
42 43 1 0
4 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.12Molecular Weight (Monoisotopic): 599.2412AlogP: 6.68#Rotatable Bonds: 7Polar Surface Area: 95.95Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.62CX Basic pKa: 9.07CX LogP: 5.71CX LogD: 4.04Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.25Np Likeness Score: -1.21
References 1. Tesch R, Rak M, Raab M, Berger LM, Kronenberger T, Joerger AC, Berger BT, Abdi I, Hanke T, Poso A, Strebhardt K, Sanhaji M, Knapp S.. (2021) Structure-Based Design of Selective Salt-Inducible Kinase Inhibitors., 64 (12.0): [PMID:34086472 ] [10.1021/acs.jmedchem.0c02144 ]