The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-(tert-butyl)isoxazol-3-yl)-3-(4-(2-(2-morpholinoethyl)-4,5-dihydro-2H-imidazo[2',1':2,3]thiazolo[4,5-e]isoindol-8-yl)phenyl)urea ID: ALA5209513
PubChem CID: 168296670
Max Phase: Preclinical
Molecular Formula: C31H35N7O3S
Molecular Weight: 585.73
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c5c(sc4n3)CCc3cn(CCN4CCOCC4)cc3-5)cc2)no1
Standard InChI: InChI=1S/C31H35N7O3S/c1-31(2,3)26-16-27(35-41-26)34-29(39)32-22-7-4-20(5-8-22)24-19-38-28-23-18-37(11-10-36-12-14-40-15-13-36)17-21(23)6-9-25(28)42-30(38)33-24/h4-5,7-8,16-19H,6,9-15H2,1-3H3,(H2,32,34,35,39)
Standard InChI Key: KBVHZRRTESSXEA-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 48 0 0 0 0 0 0 0 0999 V2000
-2.8985 -2.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1840 -2.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4695 -2.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4695 -3.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1840 -4.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8985 -3.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6848 -4.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1999 -3.4068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6848 -2.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6248 -3.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0372 -2.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8620 -2.6925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2743 -1.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0991 -1.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5115 -2.6925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0991 -3.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2743 -3.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3555 -1.7747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1759 -1.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5115 -2.4422 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.3474 -0.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6329 -0.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0199 -1.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6329 0.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3471 0.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3463 1.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6318 2.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9203 1.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9155 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6318 2.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9176 3.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2033 2.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9176 4.0650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4890 3.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4028 4.0600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4035 4.2314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8157 3.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2640 2.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6405 3.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0529 4.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6405 2.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3547 3.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
4 7 2 0
8 7 1 0
9 8 1 0
3 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
2 18 1 0
19 18 1 0
20 19 1 0
1 20 1 0
19 21 2 0
21 22 1 0
22 23 2 0
18 23 1 0
24 22 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
35 34 2 0
35 36 1 0
36 37 1 0
37 38 2 0
38 34 1 0
37 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.73Molecular Weight (Monoisotopic): 585.2522AlogP: 5.89#Rotatable Bonds: 6Polar Surface Area: 101.86Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.32CX Basic pKa: 7.28CX LogP: 5.51CX LogD: 5.45Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -1.78
References 1. Cilibrasi V, Spanò V, Bortolozzi R, Barreca M, Raimondi MV, Rocca R, Maruca A, Montalbano A, Alcaro S, Ronca R, Viola G, Barraja P.. (2022) Synthesis of 2H-Imidazo[2',1':2,3] [1,3]thiazolo[4,5-e]isoindol-8-yl-phenylureas with promising therapeutic features for the treatment of acute myeloid leukemia (AML) with FLT3/ITD mutations., 235 [PMID:35339838 ] [10.1016/j.ejmech.2022.114292 ]