The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-4-carboxylic acid {[4-(adamantan-1-ylamino)-3-nitro-phenylcarbamoyl]-methyl}-methyl-amide ID: ALA521253
PubChem CID: 44567923
Max Phase: Preclinical
Molecular Formula: C32H34N4O4
Molecular Weight: 538.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CC(=O)Nc1ccc(NC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c1)C(=O)c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C32H34N4O4/c1-35(31(38)26-9-7-25(8-10-26)24-5-3-2-4-6-24)20-30(37)33-27-11-12-28(29(16-27)36(39)40)34-32-17-21-13-22(18-32)15-23(14-21)19-32/h2-12,16,21-23,34H,13-15,17-20H2,1H3,(H,33,37)
Standard InChI Key: AOFRQEULWOEANT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
-1.0785 -14.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9412 -14.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5616 -13.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9318 -13.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5285 -13.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3592 -12.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3677 -14.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1759 -13.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6900 -14.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1341 -13.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6485 -11.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9370 -12.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2205 -11.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2233 -10.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9473 -10.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6553 -10.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3748 -10.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0889 -10.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3803 -9.6093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2056 -10.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9178 -10.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2064 -11.6527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6351 -10.8243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3516 -10.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6402 -11.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0689 -10.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3466 -9.5801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0657 -11.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7862 -12.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4997 -11.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4942 -10.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7771 -10.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2181 -12.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2233 -12.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9364 -13.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6531 -12.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6460 -12.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9280 -11.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3626 -12.0776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4890 -10.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
17 19 1 0
16 17 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
23 25 1 0
24 26 1 0
24 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
30 33 1 0
1 2 1 0
39 11 1 0
6 39 1 0
14 40 1 0
40 20 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.65Molecular Weight (Monoisotopic): 538.2580AlogP: 6.35#Rotatable Bonds: 8Polar Surface Area: 104.58Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.52CX Basic pKa: 1.98CX LogP: 5.98CX LogD: 5.98Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.44
References 1. Dömling A, Antuch W, Beck B, Schauer-Vukasinović V.. (2008) Isosteric exchange of the acylsulfonamide moiety in Abbott's Bcl-XL protein interaction antagonist., 18 (14): [PMID:18583128 ] [10.1016/j.bmcl.2008.05.096 ]