Biphenyl-4-carboxylic acid {[4-(adamantan-1-ylamino)-3-nitro-phenylcarbamoyl]-methyl}-methyl-amide

ID: ALA521253

PubChem CID: 44567923

Max Phase: Preclinical

Molecular Formula: C32H34N4O4

Molecular Weight: 538.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(CC(=O)Nc1ccc(NC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c1)C(=O)c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C32H34N4O4/c1-35(31(38)26-9-7-25(8-10-26)24-5-3-2-4-6-24)20-30(37)33-27-11-12-28(29(16-27)36(39)40)34-32-17-21-13-22(18-32)15-23(14-21)19-32/h2-12,16,21-23,34H,13-15,17-20H2,1H3,(H,33,37)

Standard InChI Key:  AOFRQEULWOEANT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   -1.0785  -14.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9412  -14.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5616  -13.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9318  -13.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5285  -13.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3592  -12.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3677  -14.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1759  -13.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6900  -14.5743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341  -13.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6485  -11.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9370  -12.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2205  -11.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2233  -10.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9473  -10.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6553  -10.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3748  -10.4330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0889  -10.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3803   -9.6093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2056  -10.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9178  -10.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2064  -11.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6351  -10.8243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3516  -10.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6402  -11.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0689  -10.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3466   -9.5801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0657  -11.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7862  -12.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4997  -11.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4942  -10.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7771  -10.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2181  -12.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2233  -12.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9364  -13.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6531  -12.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6460  -12.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9280  -11.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3626  -12.0776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4890  -10.4200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 17 19  1  0
 16 17  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 24 26  1  0
 24 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 30 33  1  0
  1  2  1  0
 39 11  1  0
  6 39  1  0
 14 40  1  0
 40 20  1  0
M  CHG  2  17   1  19  -1
M  END

Associated Targets(Human)

BCL2L2 Tchem Apoptosis regulator Bcl-W (121 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.65Molecular Weight (Monoisotopic): 538.2580AlogP: 6.35#Rotatable Bonds: 8
Polar Surface Area: 104.58Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.52CX Basic pKa: 1.98CX LogP: 5.98CX LogD: 5.98
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.44

References

1. Dömling A, Antuch W, Beck B, Schauer-Vukasinović V..  (2008)  Isosteric exchange of the acylsulfonamide moiety in Abbott's Bcl-XL protein interaction antagonist.,  18  (14): [PMID:18583128] [10.1016/j.bmcl.2008.05.096]

Source